Butyl ((3-(3-(2-(2-(tert-butyl)-1H-imidazol-1-yl)acetyl)phenyl)-5-isobutylthiophen-2-yl)sulfonyl)carbamate

ID: ALA4779819

PubChem CID: 162663560

Max Phase: Preclinical

Molecular Formula: C28H37N3O5S2

Molecular Weight: 559.75

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1cccc(C(=O)Cn2ccnc2C(C)(C)C)c1

Standard InChI:  InChI=1S/C28H37N3O5S2/c1-7-8-14-36-27(33)30-38(34,35)25-23(17-22(37-25)15-19(2)3)20-10-9-11-21(16-20)24(32)18-31-13-12-29-26(31)28(4,5)6/h9-13,16-17,19H,7-8,14-15,18H2,1-6H3,(H,30,33)

Standard InChI Key:  SKILMTRXKCIESJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
    8.8488   -7.5693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4443   -8.2792    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.2613   -8.2746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8096   -9.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4955   -9.0951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0791   -9.1788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8580  -10.3605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6760   -8.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4237   -7.2472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6065   -7.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3536   -8.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0154   -8.5033    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.5756   -8.2735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4455   -9.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0801   -9.5962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6808   -9.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9058   -6.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5737   -5.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0562   -5.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8701   -5.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2022   -6.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7201   -6.6760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6399   -4.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0429   -3.7651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8252   -4.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5581   -3.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3406   -2.9778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0217   -2.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6574   -3.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3734   -3.8006    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1759  -10.8092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4454  -10.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7633  -10.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0328  -10.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0441   -4.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2282   -4.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8305   -5.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6274   -4.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  6  2  0
  4  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
  8 12  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 11 13  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 17 22  2  0
 23 24  2  0
 23 25  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 26 30  1  0
 25 30  1  0
 19 23  1  0
  9 17  1  0
  2  8  1  0
  5  2  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
  7 31  1  0
 26 35  1  0
 35 36  1  0
 35 37  1  0
 35 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4779819

    ---

Associated Targets(Human)

AGTR2 Tchem Angiotensin II type 2 (AT-2) receptor (2549 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 559.75Molecular Weight (Monoisotopic): 559.2175AlogP: 6.21#Rotatable Bonds: 11
Polar Surface Area: 107.36Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.61CX Basic pKa: 6.92CX LogP: 5.62CX LogD: 6.14
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.22Np Likeness Score: -0.86

References

1. Wannberg J,Gising J,Lindman J,Salander J,Gutiérrez-de-Terán H,Ablahad H,Hamid S,Grönbladh A,Spizzo I,Gaspari TA,Widdop RE,Hallberg A,Backlund M,Leśniak A,Hallberg M,Larhed M.  (2021)  N-(Methyloxycarbonyl)thiophene sulfonamides as high affinity AT2 receptor ligands.,  29  [PMID:33309749] [10.1016/j.bmc.2020.115859]

Source