The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-methyl-3-(2-((S)-piperidin-3-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridine-6-carboxamide ID: ALA4779829
PubChem CID: 162663708
Max Phase: Preclinical
Molecular Formula: C19H20F3N7O
Molecular Weight: 419.41
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1ccc2c(-c3nc(N[C@H]4CCCNC4)ncc3C(F)(F)F)c[nH]c2n1
Standard InChI: InChI=1S/C19H20F3N7O/c1-23-17(30)14-5-4-11-12(8-25-16(11)28-14)15-13(19(20,21)22)9-26-18(29-15)27-10-3-2-6-24-7-10/h4-5,8-10,24H,2-3,6-7H2,1H3,(H,23,30)(H,25,28)(H,26,27,29)/t10-/m0/s1
Standard InChI Key: KNKBXFUDTNASDX-JTQLQIEISA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
15.4543 -2.3656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4532 -3.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1676 -3.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1658 -1.9530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8810 -2.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8858 -3.1880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6729 -3.4388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1546 -2.7676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6650 -2.1022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7400 -1.9534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7398 -1.1288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0260 -2.3660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3117 -1.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9309 -4.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3810 -4.8328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6398 -5.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4482 -5.7824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9973 -5.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7355 -4.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2820 -3.7641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0901 -3.9287 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.6918 -3.1736 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.2749 -2.9362 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.0913 -6.2308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3503 -7.0137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7967 -7.6261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0527 -8.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8597 -8.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4104 -7.9624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1540 -7.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
1 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
7 14 1 0
19 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
16 24 1 0
25 24 1 6
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.41Molecular Weight (Monoisotopic): 419.1681AlogP: 2.56#Rotatable Bonds: 4Polar Surface Area: 107.62Molecular Species: BASEHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.38CX Basic pKa: 9.39CX LogP: 1.92CX LogD: -0.06Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: -0.91
References 1. (2019) Inhibitors of cyclin-dependent kinase 7 (cdk7),