The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-((S)-piperidin-3-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl)-1H-indole-6-carboxylic acid ID: ALA4779846
PubChem CID: 142751803
Max Phase: Preclinical
Molecular Formula: C19H18F3N5O2
Molecular Weight: 405.38
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc2c(-c3nc(N[C@H]4CCCNC4)ncc3C(F)(F)F)c[nH]c2c1
Standard InChI: InChI=1S/C19H18F3N5O2/c20-19(21,22)14-9-25-18(26-11-2-1-5-23-7-11)27-16(14)13-8-24-15-6-10(17(28)29)3-4-12(13)15/h3-4,6,8-9,11,23-24H,1-2,5,7H2,(H,28,29)(H,25,26,27)/t11-/m0/s1
Standard InChI Key: BIJOFIPILXKNKU-NSHDSACASA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
16.4732 -19.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4721 -20.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1865 -21.1874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1847 -19.5352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8997 -19.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9045 -20.7702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6917 -21.0208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1733 -20.3497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6838 -19.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7563 -21.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0425 -20.7756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7556 -22.0130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9344 -18.9025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7414 -18.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9917 -17.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4360 -17.3320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6270 -17.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3804 -18.2963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0695 -16.9041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2646 -17.0831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7106 -16.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9087 -16.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6571 -17.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2138 -18.0433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0220 -17.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2960 -19.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0451 -20.1229 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.8765 -18.7485 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.0889 -19.5480 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 1 0
10 12 2 0
2 10 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
9 13 1 0
17 19 1 0
20 19 1 6
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
14 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.38Molecular Weight (Monoisotopic): 405.1413AlogP: 3.51#Rotatable Bonds: 4Polar Surface Area: 102.93Molecular Species: ZWITTERIONHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.63CX Basic pKa: 9.40CX LogP: 0.50CX LogD: 0.49Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: -0.65
References 1. (2019) Inhibitors of cyclin-dependent kinase 7 (cdk7),