The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-ethylbutyl((2-((4-(2,4-dimethoxypyrimidin-5-yl)-1H-imidazol-1-yl)methoxy)ethoxy)-(phenoxy)-phosphoryl)alaninate ID: ALA4779852
PubChem CID: 162662411
Max Phase: Preclinical
Molecular Formula: C26H37N6O7P
Molecular Weight: 576.59
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(CC)COC(=O)[C@H](C)NP(=O)(OCCOCn1cc(-c2cnc(N)nc2OC)cn1)Oc1ccccc1
Standard InChI: InChI=1S/C26H37N6O7P/c1-5-20(6-2)17-37-25(33)19(3)31-40(34,39-22-10-8-7-9-11-22)38-13-12-36-18-32-16-21(14-29-32)23-15-28-26(27)30-24(23)35-4/h7-11,14-16,19-20H,5-6,12-13,17-18H2,1-4H3,(H,31,34)(H2,27,28,30)/t19-,40?/m0/s1
Standard InChI Key: IDHALMMKYDOEIZ-UGNJTSMOSA-N
Molfile:
RDKit 2D
40 42 0 0 0 0 0 0 0 0999 V2000
29.4125 -2.8649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8838 -3.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1709 -4.2753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9863 -4.4140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5139 -3.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2240 -3.0011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0686 -3.3627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7027 -2.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8864 -2.7427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7477 -3.5560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4783 -3.9391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0082 -3.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3217 -3.4643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5822 -3.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8957 -3.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1562 -3.7385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3278 -3.9076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1253 -2.0915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6514 -1.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4697 -3.2811 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
21.7302 -3.6469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0437 -3.1894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3042 -3.5553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6177 -3.0977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8782 -3.4636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1917 -3.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4522 -3.3719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2513 -4.3785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7657 -2.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2446 -2.1828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5580 -1.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5485 -4.0993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2993 -4.4413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3752 -5.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1252 -5.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7977 -5.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7154 -4.3003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9653 -3.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4625 -2.4541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0966 -2.3661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 7 2 0
2 7 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
5 17 1 0
1 18 1 0
18 19 1 0
16 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
23 28 2 0
27 29 1 0
26 30 1 0
30 31 1 0
20 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
20 39 2 0
22 40 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 576.59Molecular Weight (Monoisotopic): 576.2461AlogP: 4.07#Rotatable Bonds: 17Polar Surface Area: 161.94Molecular Species: NEUTRALHBA: 12HBD: 2#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.24CX Basic pKa: 4.54CX LogP: 3.67CX LogD: 3.67Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.13Np Likeness Score: -0.54
References 1. Thames JE,Waters CD,Valle C,Bassetto M,Aouadi W,Martin B,Selisko B,Falat A,Coutard B,Brancale A,Canard B,Decroly E,Seley-Radtke KL. (2020) Synthesis and biological evaluation of novel flexible nucleoside analogues that inhibit flavivirus replication in vitro., 28 (22): [PMID:33128910 ] [10.1016/j.bmc.2020.115713 ]