The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((5-(4-(1-(5-cyclopropyl-1H-pyrazol-3-ylamino)-1-oxopropan-2-yl)phenyl)pyridin-2-yl)methyl)acrylamide ID: ALA4779861
PubChem CID: 162662506
Max Phase: Preclinical
Molecular Formula: C24H25N5O2
Molecular Weight: 415.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)NCc1ccc(-c2ccc(C(C)C(=O)Nc3cc(C4CC4)[nH]n3)cc2)cn1
Standard InChI: InChI=1S/C24H25N5O2/c1-3-23(30)26-14-20-11-10-19(13-25-20)17-6-4-16(5-7-17)15(2)24(31)27-22-12-21(28-29-22)18-8-9-18/h3-7,10-13,15,18H,1,8-9,14H2,2H3,(H,26,30)(H2,27,28,29,31)
Standard InChI Key: PGXJEYUKDHAXSS-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
5.5727 -13.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2856 -13.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9945 -13.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9945 -14.3511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2881 -14.7646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5727 -14.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8557 -14.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1427 -14.3564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4298 -14.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7169 -14.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9999 -14.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4298 -15.5919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7115 -13.1156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7119 -12.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4223 -11.8828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1355 -12.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1377 -13.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4289 -13.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8485 -11.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8485 -11.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5655 -12.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5655 -13.1184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2784 -11.8830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9913 -12.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7084 -11.8830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3259 -12.4536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9950 -13.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1714 -13.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4054 -13.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4054 -14.7268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1219 -14.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
9 12 2 0
13 3 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
19 20 1 0
19 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
25 24 2 0
25 26 1 0
26 27 1 0
28 27 2 0
24 28 1 0
29 27 1 0
29 30 1 0
30 31 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.50Molecular Weight (Monoisotopic): 415.2008AlogP: 3.89#Rotatable Bonds: 8Polar Surface Area: 99.77Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.26CX Basic pKa: 3.75CX LogP: 3.32CX LogD: 3.32Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -1.11
References 1. (2020) Substituted 5-cyclopropyl-1h-pyrazol-3-yl-amine derivatives as selective cdk12/13 inhibitors,