Ethyl ((3-(3-(2-(2-(tert-butyl)-1H-imidazol-1-yl)acetyl)phenyl)-5-isobutylthiophen-2-yl)sulfonyl)carbamate

ID: ALA4779945

PubChem CID: 162663467

Max Phase: Preclinical

Molecular Formula: C26H33N3O5S2

Molecular Weight: 531.70

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1cccc(C(=O)Cn2ccnc2C(C)(C)C)c1

Standard InChI:  InChI=1S/C26H33N3O5S2/c1-7-34-25(31)28-36(32,33)23-21(15-20(35-23)13-17(2)3)18-9-8-10-19(14-18)22(30)16-29-12-11-27-24(29)26(4,5)6/h8-12,14-15,17H,7,13,16H2,1-6H3,(H,28,31)

Standard InChI Key:  IJAQKLZXRPAQPR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    9.3977   -5.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8199   -5.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6084   -6.1423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3788   -8.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6781   -7.5388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2678  -10.0485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8514  -10.1322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9745   -6.9676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5819  -10.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9963  -12.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1259   -8.9746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5975   -5.4351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8285   -6.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2166   -9.2326    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.4297   -3.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6424   -6.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4483   -8.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3460   -6.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1457   -4.7540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6303  -11.3139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4530  -10.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0336   -9.2279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6211   -8.5227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8524  -10.5496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7877   -9.4567    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.9482  -11.7626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7940   -3.4794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1129   -3.9312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3304   -4.7178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1959   -8.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3479   -9.2269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4924   -7.6294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2178  -10.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8151   -4.7185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4122   -5.4274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0123   -5.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
 13 35  1  0
 11 25  1  0
 20 26  1  0
 18 13  2  0
  5 32  2  0
 29  2  1  0
 33 21  1  0
 27 15  2  0
  8 32  1  0
 17 25  1  0
 35 34  2  0
 22 14  2  0
 28 27  1  0
 33 24  1  0
 30  5  1  0
 17 30  2  0
 31 33  1  0
 30  4  1  0
 14 17  1  0
 13 16  1  0
  9  7  2  0
  6 14  1  0
 29 28  2  0
 35 12  1  0
 14 23  2  0
 12 19  1  0
  9 20  1  0
 26 10  1  0
 15 19  1  0
 16  8  2  0
 29 19  1  0
  4 11  2  0
 11 31  1  0
  9  6  1  0
  5 18  1  0
  2 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4779945

    ---

Associated Targets(Human)

AGTR2 Tchem Angiotensin II type 2 (AT-2) receptor (2549 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 531.70Molecular Weight (Monoisotopic): 531.1862AlogP: 5.43#Rotatable Bonds: 9
Polar Surface Area: 107.36Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.61CX Basic pKa: 6.92CX LogP: 4.66CX LogD: 5.17
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -0.96

References

1. Wannberg J,Gising J,Lindman J,Salander J,Gutiérrez-de-Terán H,Ablahad H,Hamid S,Grönbladh A,Spizzo I,Gaspari TA,Widdop RE,Hallberg A,Backlund M,Leśniak A,Hallberg M,Larhed M.  (2021)  N-(Methyloxycarbonyl)thiophene sulfonamides as high affinity AT2 receptor ligands.,  29  [PMID:33309749] [10.1016/j.bmc.2020.115859]

Source