The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(Piperidin-l-yl)-phenylmethyl-magnolol ID: ALA4779961
PubChem CID: 162663825
Max Phase: Preclinical
Molecular Formula: C30H33NO2
Molecular Weight: 439.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCc1ccc(O)c(-c2cc(CC=C)cc(C(c3ccccc3)N3CCCCC3)c2O)c1
Standard InChI: InChI=1S/C30H33NO2/c1-3-11-22-15-16-28(32)25(19-22)26-20-23(12-4-2)21-27(30(26)33)29(24-13-7-5-8-14-24)31-17-9-6-10-18-31/h3-5,7-8,13-16,19-21,29,32-33H,1-2,6,9-12,17-18H2
Standard InChI Key: YBPOFTFSAGTUDG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.8481 -1.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1097 -1.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0497 -2.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7271 -3.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4666 -2.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5231 -1.8693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1417 -3.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0835 -3.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7603 -4.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4956 -4.0528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5501 -3.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8725 -2.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9271 -1.9648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2577 -1.5115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7031 -5.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9685 -5.5844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9113 -6.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3138 -2.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6381 -2.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9023 -2.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2832 -2.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9624 -3.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9032 -4.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5815 -4.5975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3157 -4.2365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3672 -3.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6880 -2.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3372 -2.0567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0723 -1.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1279 -0.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4508 -0.4277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7159 -0.7874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6582 -1.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
12 13 1 0
6 14 1 0
9 15 1 0
15 16 1 0
16 17 2 0
3 18 1 0
18 19 1 0
19 20 2 0
11 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.60Molecular Weight (Monoisotopic): 439.2511AlogP: 6.80#Rotatable Bonds: 8Polar Surface Area: 43.70Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.46CX Basic pKa: 10.49CX LogP: 6.42CX LogD: 6.12Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: 0.22
References 1. Xu T,Zheng Z,Guo Y,Bai LP. (2020) Semisynthesis of novel magnolol-based Mannich base derivatives that suppress cancer cells via inducing autophagy., 205 [PMID:32791403 ] [10.1016/j.ejmech.2020.112663 ]