The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(10-(2,5-dihydroxybenzoyloxy)decyl)triphenylphosphonium bromide ID: ALA4780051
PubChem CID: 162663294
Max Phase: Preclinical
Molecular Formula: C35H40BrO4P
Molecular Weight: 555.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(OCCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1cc(O)ccc1O.[Br-]
Standard InChI: InChI=1S/C35H39O4P.BrH/c36-29-24-25-34(37)33(28-29)35(38)39-26-16-5-3-1-2-4-6-17-27-40(30-18-10-7-11-19-30,31-20-12-8-13-21-31)32-22-14-9-15-23-32;/h7-15,18-25,28H,1-6,16-17,26-27H2,(H-,36,37,38);1H
Standard InChI Key: DFZNRLVOLKZGLG-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 43 0 0 0 0 0 0 0 0999 V2000
18.1516 -9.5587 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
15.6825 -6.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6814 -7.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3894 -7.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0991 -7.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0963 -6.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3877 -6.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2225 -1.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2214 -1.9710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9294 -2.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6391 -1.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6362 -1.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9276 -0.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5133 -2.3790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9292 -3.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2214 -3.6056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6368 -3.6059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2212 -4.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5134 -4.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5132 -5.6484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8054 -6.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8052 -6.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0974 -7.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0972 -8.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3894 -8.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6817 -8.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9739 -8.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2663 -8.0989 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
17.5585 -8.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2665 -7.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9752 -6.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9758 -6.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2676 -5.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5575 -6.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5604 -6.8772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8530 -8.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1457 -8.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1450 -9.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8576 -9.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5620 -9.3194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3424 -0.7366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
9 14 1 0
10 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
28 5 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
29 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 29 1 0
12 41 1 0
M CHG 2 1 -1 28 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.68Molecular Weight (Monoisotopic): 555.2659AlogP: 7.37#Rotatable Bonds: 15Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.56CX Basic pKa: ┄CX LogP: 9.72CX LogD: 9.72Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.07Np Likeness Score: 0.22
References 1. CatalAn, Mabel, Castro-Castillo, Vicente, Gajardo-de la Fuente, Javier, Aguilera, Jocelyn, Ferreira, Jorge, Ramires-Fernandez, Ricardo, Olmedo, Ivonne, Molina-Berrios, Alfredo, Palominos, Charlotte, Valencia, Marcelo, Dominguez, Marta, Souto, Jose A., Jara, Jose A.. (2020) Continuous flow synthesis of lipophilic cations derived from benzoic acid as new cytotoxic chemical entities in human head and neck carcinoma cell lines, 11 (10): [PMID:33479625 ] [10.1039/d0md00153h ]