(S,Z)-N-(1-bromo-3-((1-hydroxy-3-phenylpropan-2-yl)amino)-1-(3-methoxyphenyl)-3-oxoprop-1-en-2-yl)benzamide

ID: ALA4780094

PubChem CID: 162662516

Max Phase: Preclinical

Molecular Formula: C26H25BrN2O4

Molecular Weight: 509.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(/C(Br)=C(/NC(=O)c2ccccc2)C(=O)N[C@H](CO)Cc2ccccc2)c1

Standard InChI:  InChI=1S/C26H25BrN2O4/c1-33-22-14-8-13-20(16-22)23(27)24(29-25(31)19-11-6-3-7-12-19)26(32)28-21(17-30)15-18-9-4-2-5-10-18/h2-14,16,21,30H,15,17H2,1H3,(H,28,32)(H,29,31)/b24-23-/t21-/m0/s1

Standard InChI Key:  VLXCJHAFDWKACN-HGJUWQSKSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   32.3932   -1.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3921   -2.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1001   -2.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8098   -2.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8069   -1.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0983   -0.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0999   -3.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3921   -3.6964    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   33.8075   -3.6967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8073   -4.5139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5153   -3.2883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2229   -3.6971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5155   -2.4711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9307   -3.2886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6383   -3.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9309   -2.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6387   -2.0630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6381   -4.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5149   -4.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5147   -5.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2227   -4.5143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.8079   -6.1461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8073   -6.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5155   -7.3721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2256   -6.9593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2227   -6.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9307   -4.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9302   -5.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6383   -6.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3485   -5.7320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3455   -4.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6854   -0.8338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6852   -0.0166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  6
 14 15  1  0
 14 16  1  0
 16 17  1  0
 15 18  1  0
 10 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 20  1  0
 18 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 18  1  0
  1 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4780094

    ---

Associated Targets(Human)

HepG2 2.2.15 (869 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis B virus (7925 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.40Molecular Weight (Monoisotopic): 508.0998AlogP: 3.91#Rotatable Bonds: 9
Polar Surface Area: 87.66Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.11CX Basic pKa: CX LogP: 3.61CX LogD: 3.61
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -0.50

References

1. Gu X,Zhang Y,Zou Y,Li X,Guan M,Zhou Q,Qiu J.  (2021)  Synthesis and evaluation of new phenyl acrylamide derivatives as potent non-nucleoside anti-HBV agents.,  29  [PMID:33285406] [10.1016/j.bmc.2020.115892]

Source