The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(6-(5-fluoropyridin-3-yl)-1H-indol-3-yl)-N-((S)-piperidin-3-yl)-5-(trifluoromethyl)pyrimidin-2-amine ID: ALA4780112
PubChem CID: 162662848
Max Phase: Preclinical
Molecular Formula: C23H20F4N6
Molecular Weight: 456.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Fc1cncc(-c2ccc3c(-c4nc(N[C@H]5CCCNC5)ncc4C(F)(F)F)c[nH]c3c2)c1
Standard InChI: InChI=1S/C23H20F4N6/c24-15-6-14(8-29-9-15)13-3-4-17-18(11-30-20(17)7-13)21-19(23(25,26)27)12-31-22(33-21)32-16-2-1-5-28-10-16/h3-4,6-9,11-12,16,28,30H,1-2,5,10H2,(H,31,32,33)/t16-/m0/s1
Standard InChI Key: PDCIXCSHUGGJPD-INIZCTEOSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
5.4040 -9.6305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4028 -10.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1184 -10.8720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8355 -10.4582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8327 -9.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1166 -9.2173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5432 -9.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2603 -9.6245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2490 -7.9728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5388 -8.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9708 -8.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9737 -9.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7589 -9.4595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2413 -8.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7541 -8.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0045 -7.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8130 -7.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0655 -6.3824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5104 -5.7698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6996 -5.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4510 -6.7331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1427 -5.3382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3361 -5.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7834 -4.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9800 -5.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7263 -5.8642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2824 -6.4760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0923 -6.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6888 -9.2177 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.3671 -7.7802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1140 -8.5662 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.0789 -7.3616 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.0789 -8.1916 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 12 1 0
11 9 1 0
9 10 2 0
10 7 1 0
5 7 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 11 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
15 16 1 0
20 22 1 0
23 22 1 6
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
1 29 1 0
17 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.45Molecular Weight (Monoisotopic): 456.1686AlogP: 5.01#Rotatable Bonds: 4Polar Surface Area: 78.52Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.40CX LogP: 3.88CX LogD: 1.91Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -0.90
References 1. (2019) Inhibitors of cyclin-dependent kinase 7 (cdk7),