Ethyl 2-(4-(1-(3,4-dimethylphenyl)-4-oxo-4,5-dihydro-1H-pyrazolo[3,4-d]pyrimidin-6-yl)phenoxy)propanoate

ID: ALA4780120

PubChem CID: 162663069

Max Phase: Preclinical

Molecular Formula: C24H24N4O4

Molecular Weight: 432.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)C(C)Oc1ccc(-c2nc3c(cnn3-c3ccc(C)c(C)c3)c(=O)[nH]2)cc1

Standard InChI:  InChI=1S/C24H24N4O4/c1-5-31-24(30)16(4)32-19-10-7-17(8-11-19)21-26-22-20(23(29)27-21)13-25-28(22)18-9-6-14(2)15(3)12-18/h6-13,16H,5H2,1-4H3,(H,26,27,29)

Standard InChI Key:  PRZUREVROUBMAX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   29.0863  -16.2696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0852  -17.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8010  -17.5085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5184  -17.0969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5156  -16.2660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7991  -15.8545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2265  -15.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9437  -16.2635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.9325  -14.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2221  -15.0276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6545  -15.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6574  -15.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4425  -16.0953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9223  -15.4300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.4377  -14.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6963  -16.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1430  -17.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3990  -18.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2080  -18.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7604  -17.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5015  -17.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9265  -13.7871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3694  -17.5076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6543  -17.0963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9426  -17.5064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2275  -17.0952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5117  -17.5052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9419  -18.3318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4697  -19.2295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5691  -17.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6539  -16.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8017  -17.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8 12  1  0
 11  9  1  0
  9 10  1  0
 10  7  1  0
  5  7  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 13 16  1  0
  9 22  2  0
  2 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  2  0
 19 29  1  0
 20 30  1  0
 24 31  1  0
 27 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4780120

    ---

Associated Targets(non-human)

L6 (7924 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.48Molecular Weight (Monoisotopic): 432.1798AlogP: 3.72#Rotatable Bonds: 6
Polar Surface Area: 99.10Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.24CX Basic pKa: CX LogP: 4.22CX LogD: 4.22
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -1.77

References

1. Gupta S,Rai AK,Pandey S,Singh LR,Kant R,Tamrakar AK,Sashidhara KV.  (2021)  Microwave-assisted efficient synthesis of pyrazole-fibrate derivatives as stimulators of glucose uptake in skeletal muscle cells.,  34  [PMID:33359606] [10.1016/j.bmcl.2020.127760]

Source