The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(benzylthio)-6-(2-(dimethylamino)ethoxy)-3-(furan-2-ylmethyl)quinazolin-4(3H)-one ID: ALA4780181
PubChem CID: 162663581
Max Phase: Preclinical
Molecular Formula: C24H25N3O3S
Molecular Weight: 435.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCOc1ccc2nc(SCc3ccccc3)n(Cc3ccco3)c(=O)c2c1
Standard InChI: InChI=1S/C24H25N3O3S/c1-26(2)12-14-30-19-10-11-22-21(15-19)23(28)27(16-20-9-6-13-29-20)24(25-22)31-17-18-7-4-3-5-8-18/h3-11,13,15H,12,14,16-17H2,1-2H3
Standard InChI Key: AOMJZZGDRCJYCK-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
37.6513 -18.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6501 -19.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3582 -19.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3564 -17.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0650 -18.3254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0638 -19.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7739 -19.5619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4898 -19.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4910 -18.3274 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7763 -17.9115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7763 -17.0943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9435 -17.9206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2359 -18.3293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1997 -17.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9064 -18.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1963 -19.5632 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
41.1940 -20.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9006 -20.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8946 -21.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6003 -22.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3101 -21.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3098 -20.7895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6035 -20.3827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9870 -19.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7860 -19.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1963 -18.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6509 -17.9977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.5281 -17.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8205 -18.3297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.1126 -17.9212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8206 -19.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
1 12 1 0
12 13 1 0
9 14 1 0
14 15 1 0
8 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 15 1 0
13 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.55Molecular Weight (Monoisotopic): 435.1617AlogP: 4.27#Rotatable Bonds: 9Polar Surface Area: 60.50Molecular Species: BASEHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.73CX LogP: 4.64CX LogD: 3.29Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.29Np Likeness Score: -1.91
References 1. Qiu J,Zhou Q,Zhang Y,Guan M,Li X,Zou Y,Huang X,Zhao Y,Chen W,Gu X. (2020) Discovery of novel quinazolinone derivatives as potential anti-HBV and anti-HCC agents., 205 [PMID:32791397 ] [10.1016/j.ejmech.2020.112581 ]