N-(5-(2-Amino-5-(3-(methylsulfonyl)phenyl)pyridin-3-yl)-2-methoxyphenyl)propane-1-sulfonamide

ID: ALA4780183

PubChem CID: 135348349

Max Phase: Preclinical

Molecular Formula: C22H25N3O5S2

Molecular Weight: 475.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCS(=O)(=O)Nc1cc(-c2cc(-c3cccc(S(C)(=O)=O)c3)cnc2N)ccc1OC

Standard InChI:  InChI=1S/C22H25N3O5S2/c1-4-10-32(28,29)25-20-13-16(8-9-21(20)30-2)19-12-17(14-24-22(19)23)15-6-5-7-18(11-15)31(3,26)27/h5-9,11-14,25H,4,10H2,1-3H3,(H2,23,24)

Standard InChI Key:  KAEJEDBJAIIDDU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   34.7246  -21.5058    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.3136  -20.8031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9077  -21.5123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0874  -24.7858    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.4997  -25.4962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9089  -24.7888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.7972  -22.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7960  -23.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5041  -23.9695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2137  -23.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2109  -22.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5023  -22.3321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9221  -23.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9185  -24.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6260  -25.1925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3341  -24.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3302  -23.9613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6221  -23.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0358  -23.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7410  -23.9577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4461  -23.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4424  -22.7281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7276  -22.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0254  -22.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2102  -25.1925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0880  -23.9686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0894  -22.3326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3793  -25.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6719  -24.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9639  -25.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0892  -21.5154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4308  -21.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  1  3  2  0
  5  4  2  0
  4  6  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 14 25  1  0
  8 26  1  0
  7 27  1  0
 26  4  1  0
  4 28  1  0
 28 29  1  0
 29 30  1  0
 27 31  1  0
 23  1  1  0
  1 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4780183

    ---

Associated Targets(Human)

RIPK2 Tchem Serine/threonine-protein kinase RIPK2 (1546 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ACVR1 Tchem Activin receptor type-1 (1516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.59Molecular Weight (Monoisotopic): 475.1236AlogP: 3.56#Rotatable Bonds: 8
Polar Surface Area: 128.45Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.83CX Basic pKa: 5.99CX LogP: 1.81CX LogD: 1.76
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: -1.28

References

1. Suebsuwong C,Dai B,Pinkas DM,Duddupudi AL,Li L,Bufton JC,Schlicher L,Gyrd-Hansen M,Hu M,Bullock AN,Degterev A,Cuny GD.  (2020)  Receptor-interacting protein kinase 2 (RIPK2) and nucleotide-binding oligomerization domain (NOD) cell signaling inhibitors based on a 3,5-diphenyl-2-aminopyridine scaffold.,  200  [PMID:32505849] [10.1016/j.ejmech.2020.112417]

Source