The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(2-Amino-5-(3-(methylsulfonyl)phenyl)pyridin-3-yl)-2-methoxyphenyl)propane-1-sulfonamide ID: ALA4780183
PubChem CID: 135348349
Max Phase: Preclinical
Molecular Formula: C22H25N3O5S2
Molecular Weight: 475.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCS(=O)(=O)Nc1cc(-c2cc(-c3cccc(S(C)(=O)=O)c3)cnc2N)ccc1OC
Standard InChI: InChI=1S/C22H25N3O5S2/c1-4-10-32(28,29)25-20-13-16(8-9-21(20)30-2)19-12-17(14-24-22(19)23)15-6-5-7-18(11-15)31(3,26)27/h5-9,11-14,25H,4,10H2,1-3H3,(H2,23,24)
Standard InChI Key: KAEJEDBJAIIDDU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
34.7246 -21.5058 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.3136 -20.8031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9077 -21.5123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0874 -24.7858 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.4997 -25.4962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9089 -24.7888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7972 -22.7410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7960 -23.5605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5041 -23.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2137 -23.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2109 -22.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5023 -22.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9221 -23.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9185 -24.7851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6260 -25.1925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3341 -24.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3302 -23.9613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6221 -23.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0358 -23.5491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7410 -23.9577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4461 -23.5462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4424 -22.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7276 -22.3233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0254 -22.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2102 -25.1925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0880 -23.9686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0894 -22.3326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3793 -25.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6719 -24.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9639 -25.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0892 -21.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4308 -21.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
5 4 2 0
4 6 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
14 25 1 0
8 26 1 0
7 27 1 0
26 4 1 0
4 28 1 0
28 29 1 0
29 30 1 0
27 31 1 0
23 1 1 0
1 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.59Molecular Weight (Monoisotopic): 475.1236AlogP: 3.56#Rotatable Bonds: 8Polar Surface Area: 128.45Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.83CX Basic pKa: 5.99CX LogP: 1.81CX LogD: 1.76Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: -1.28
References 1. Suebsuwong C,Dai B,Pinkas DM,Duddupudi AL,Li L,Bufton JC,Schlicher L,Gyrd-Hansen M,Hu M,Bullock AN,Degterev A,Cuny GD. (2020) Receptor-interacting protein kinase 2 (RIPK2) and nucleotide-binding oligomerization domain (NOD) cell signaling inhibitors based on a 3,5-diphenyl-2-aminopyridine scaffold., 200 [PMID:32505849 ] [10.1016/j.ejmech.2020.112417 ]