The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-((S)-2-acetamido-3-(benzyloxy)propanamido)-N-((R)-1-(hydroxyamino)-1-oxo-3-o-tolylpropan-2-yl)-4-phenylbutanamide ID: ALA4780250
PubChem CID: 162662594
Max Phase: Preclinical
Molecular Formula: C32H38N4O6
Molecular Weight: 574.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@@H](COCc1ccccc1)C(=O)N[C@H](CCc1ccccc1)C(=O)N[C@H](Cc1ccccc1C)C(=O)NO
Standard InChI: InChI=1S/C32H38N4O6/c1-22-11-9-10-16-26(22)19-28(32(40)36-41)35-30(38)27(18-17-24-12-5-3-6-13-24)34-31(39)29(33-23(2)37)21-42-20-25-14-7-4-8-15-25/h3-16,27-29,41H,17-21H2,1-2H3,(H,33,37)(H,34,39)(H,35,38)(H,36,40)/t27-,28-,29+/m1/s1
Standard InChI Key: ZFSGZQVLZQCFKH-NLDZOOGBSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
33.5752 -18.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2897 -17.6251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8607 -17.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5752 -18.8627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0041 -18.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7186 -17.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4331 -18.0376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7186 -16.8001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1476 -17.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8621 -18.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1476 -16.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8621 -18.8627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5766 -17.6251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2910 -18.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0055 -17.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2910 -18.8627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0055 -19.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7200 -18.0376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.4344 -17.6251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0055 -16.8001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0017 -20.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7152 -20.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4307 -20.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4281 -19.2718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7139 -18.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0041 -18.8627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7186 -19.2752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7186 -20.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4331 -20.5126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4307 -21.3387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1444 -21.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8599 -21.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8573 -20.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1430 -20.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8621 -16.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8621 -15.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5785 -15.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5789 -14.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8638 -13.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1470 -14.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1502 -15.1536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2861 -20.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 1 0
9 11 1 6
10 12 2 0
10 13 1 0
13 14 1 0
14 15 1 0
14 16 1 1
16 17 1 0
15 18 1 0
18 19 1 0
15 20 2 0
17 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 17 1 0
5 26 1 6
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
11 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
21 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.68Molecular Weight (Monoisotopic): 574.2791AlogP: 2.37#Rotatable Bonds: 15Polar Surface Area: 145.86Molecular Species: NEUTRALHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.72CX Basic pKa: ┄CX LogP: 2.95CX LogD: 2.93Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.14Np Likeness Score: -0.17
References 1. Baggio C,Velazquez JV,Fragai M,Nordgren TM,Pellecchia M. (2020) Therapeutic Targeting of MMP-12 for the Treatment of Chronic Obstructive Pulmonary Disease., 63 (21): [PMID:33107733 ] [10.1021/acs.jmedchem.0c01285 ]