4-(9-(3-(4-chloro-3-(trifluoromethyl)phenyl)ureido)-5-oxobenzo[b]pyrido[3,2-f][1,4]oxazepin-6(5H)-yl)-N-methylpicolinamide

ID: ALA4780260

PubChem CID: 162662606

Max Phase: Preclinical

Molecular Formula: C27H18ClF3N6O4

Molecular Weight: 582.93

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)c1cc(N2C(=O)c3cccnc3Oc3cc(NC(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)ccc32)ccn1

Standard InChI:  InChI=1S/C27H18ClF3N6O4/c1-32-23(38)20-13-16(8-10-33-20)37-21-7-5-15(12-22(21)41-24-17(25(37)39)3-2-9-34-24)36-26(40)35-14-4-6-19(28)18(11-14)27(29,30)31/h2-13H,1H3,(H,32,38)(H2,35,36,40)

Standard InChI Key:  JGLSUCDVLIJDRY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   12.6703  -13.4577    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.8703  -13.2453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0842  -14.0407    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.7232  -11.1738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0116  -10.7613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0675  -11.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4224  -10.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2285  -10.6569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8724  -11.1738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8724  -11.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2285  -12.5114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4224  -12.3249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9641  -10.1648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1426  -10.2248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7794  -10.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2461  -11.6463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5841  -12.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2999  -11.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2999  -11.1738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5841  -10.7613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3714  -14.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1969  -13.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3988  -13.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8190  -13.8845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9935  -14.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7874  -14.9341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9139  -12.9689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7234  -12.0029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4418  -10.7569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1604  -11.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1552  -12.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8731  -12.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5925  -12.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5898  -11.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8713  -10.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3118  -12.4116    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.1541  -13.6584    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.1627  -14.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3607  -15.3894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7644  -14.0104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5599  -14.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  6 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
  6 16  2  0
  7 13  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
  9 20  2  0
 10 17  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 21 26  2  0
 11 23  1  0
 12 27  2  0
  5 19  1  0
  4 28  2  0
  4 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 33 36  1  0
 32  2  1  0
  2 37  1  0
 21 38  1  0
 38 39  2  0
 38 40  1  0
 40 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4780260

    ---

Associated Targets(Human)

CDK8 Tchem Cell division protein kinase 8 (1536 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 582.93Molecular Weight (Monoisotopic): 582.1030AlogP: 6.24#Rotatable Bonds: 4
Polar Surface Area: 125.55Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.33CX Basic pKa: 2.30CX LogP: 4.36CX LogD: 4.36
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.26Np Likeness Score: -1.52

References

1. Martínez-González S,García AB,Albarrán MI,Cebriá A,Amezquita-Alves A,García-Campos FJ,Martínez-Gago J,Martínez-Torrecuadrada J,Muñoz IG,Blanco-Aparicio C,Pastor J.  (2020)  Pyrido[2,3-b][1,5]benzoxazepin-5(6H)-one derivatives as CDK8 inhibitors.,  201  [PMID:32599324] [10.1016/j.ejmech.2020.112443]

Source