The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'-((1H-pyrrol-2-yl)methylene)-2,2-bis(4-(trifluoromethoxy)phenyl)cyclopropanecarbohydrazide ID: ALA4780283
PubChem CID: 162662676
Max Phase: Preclinical
Molecular Formula: C23H17F6N3O3
Molecular Weight: 497.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N/N=C/c1ccc[nH]1)C1CC1(c1ccc(OC(F)(F)F)cc1)c1ccc(OC(F)(F)F)cc1
Standard InChI: InChI=1S/C23H17F6N3O3/c24-22(25,26)34-17-7-3-14(4-8-17)21(15-5-9-18(10-6-15)35-23(27,28)29)12-19(21)20(33)32-31-13-16-2-1-11-30-16/h1-11,13,19,30H,12H2,(H,32,33)/b31-13+
Standard InChI Key: PNVCUPJXEPOSCJ-IURWMYGYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
23.9849 -19.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2103 -18.6675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4101 -18.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0275 -18.6675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6189 -17.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1585 -17.7223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3591 -17.5544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8129 -18.1639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0715 -18.9439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8703 -19.1081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1913 -19.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9657 -20.4362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5356 -21.0263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3341 -20.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5559 -20.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7350 -19.0764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7346 -19.8936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4429 -18.6682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1504 -19.0772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8583 -18.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5658 -19.0779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6482 -19.8894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4474 -20.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8564 -19.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3099 -18.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0128 -17.9973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7571 -17.2211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3118 -21.8122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5193 -22.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9571 -17.0546 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.3014 -16.6116 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.5412 -16.4264 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.9505 -21.4246 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.2955 -22.7974 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.7257 -22.2210 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
5 4 1 0
2 5 1 0
3 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 3 1 0
1 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 1 1 0
4 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 2 0
8 26 1 0
26 27 1 0
13 28 1 0
28 29 1 0
27 30 1 0
27 31 1 0
27 32 1 0
29 33 1 0
29 34 1 0
29 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.39Molecular Weight (Monoisotopic): 497.1174AlogP: 5.27#Rotatable Bonds: 7Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.77CX Basic pKa: 1.35CX LogP: 6.61CX LogD: 6.61Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -0.68
References 1. McNulty J,Babu Dokuburra C,D'Aiuto L,Demers M,McClain L,Piazza P,Williamson K,Zheng W,Nimgaonkar VL. (2020) Synthesis of non-nucleoside anti-viral cyclopropylcarboxacyl hydrazones and initial anti-HSV-1 structure-activity relationship studies., 30 (24): [PMID:32961320 ] [10.1016/j.bmcl.2020.127559 ]