The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(6-(difluoromethylsulfonyl)-1H-indol-3-yl)-N-((S)-piperidin-3-yl)-5-(trifluoromethyl)pyrimidin-2-amine ID: ALA4780373
PubChem CID: 142751778
Max Phase: Preclinical
Molecular Formula: C19H18F5N5O2S
Molecular Weight: 475.44
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1ccc2c(-c3nc(N[C@H]4CCCNC4)ncc3C(F)(F)F)c[nH]c2c1)C(F)F
Standard InChI: InChI=1S/C19H18F5N5O2S/c20-17(21)32(30,31)11-3-4-12-13(8-26-15(12)6-11)16-14(19(22,23)24)9-27-18(29-16)28-10-2-1-5-25-7-10/h3-4,6,8-10,17,25-26H,1-2,5,7H2,(H,27,28,29)/t10-/m0/s1
Standard InChI Key: JMDJVTKHPSFJBK-JTQLQIEISA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
4.6853 -22.5062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2772 -21.7941 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.8645 -22.5036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9963 -20.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9951 -21.3841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7096 -21.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7078 -20.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4229 -20.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4277 -21.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2148 -21.6302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6965 -20.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2070 -20.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4577 -19.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2646 -19.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5149 -18.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9593 -17.9412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1501 -18.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9036 -18.9055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5926 -17.5133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7876 -17.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2335 -17.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4317 -17.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1801 -18.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7368 -18.6525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5451 -18.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8193 -19.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5683 -20.7323 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.5289 -19.5285 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.5289 -20.3573 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.5668 -21.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8524 -21.7947 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.5674 -20.5584 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
12 13 1 0
17 19 1 0
20 19 1 6
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
14 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
5 2 1 0
2 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.44Molecular Weight (Monoisotopic): 475.1101AlogP: 3.80#Rotatable Bonds: 5Polar Surface Area: 99.77Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.79CX Basic pKa: 9.40CX LogP: 3.75CX LogD: 1.77Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: -1.17
References 1. (2019) Inhibitors of cyclin-dependent kinase 7 (cdk7),