The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-(2-((S)-piperidin-3-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl)-1H-indol-6-yl)benzenesulfonamide ID: ALA4780460
PubChem CID: 162662990
Max Phase: Preclinical
Molecular Formula: C24H23F3N6O2S
Molecular Weight: 516.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)c1ccc(-c2ccc3c(-c4nc(N[C@H]5CCCNC5)ncc4C(F)(F)F)c[nH]c3c2)cc1
Standard InChI: InChI=1S/C24H23F3N6O2S/c25-24(26,27)20-13-31-23(32-16-2-1-9-29-11-16)33-22(20)19-12-30-21-10-15(5-8-18(19)21)14-3-6-17(7-4-14)36(28,34)35/h3-8,10,12-13,16,29-30H,1-2,9,11H2,(H2,28,34,35)(H,31,32,33)/t16-/m0/s1
Standard InChI Key: WOSCFDBVQAKFEG-INIZCTEOSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
3.1029 -9.0878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6947 -8.3757 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.2819 -9.0852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5545 -5.9058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5534 -6.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2679 -7.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2661 -5.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9811 -5.9022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9860 -6.7283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7732 -6.9789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2549 -6.3078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7653 -5.6423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0160 -4.8603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8230 -4.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0734 -3.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5176 -3.2898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7085 -3.4694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4619 -4.2541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1510 -2.8618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3460 -3.0408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7919 -2.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9899 -2.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7384 -3.3915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2951 -4.0011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1034 -3.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3778 -5.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1267 -6.0809 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.0873 -4.8771 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.0873 -5.7059 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8408 -7.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1267 -6.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4127 -7.1413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4116 -7.9669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1305 -8.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8415 -7.9662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9832 -7.9676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
12 13 1 0
17 19 1 0
20 19 1 6
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
14 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
5 30 1 0
33 2 1 0
2 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.55Molecular Weight (Monoisotopic): 516.1555AlogP: 4.12#Rotatable Bonds: 5Polar Surface Area: 125.79Molecular Species: BASEHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.29CX Basic pKa: 9.34CX LogP: 3.30CX LogD: 1.59Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.32Np Likeness Score: -0.92
References 1. (2019) Inhibitors of cyclin-dependent kinase 7 (cdk7),