2-Chloro-9-(pyridin-2-ylmethyl)-9H-purin-6-amine

ID: ALA4780510

PubChem CID: 29928926

Max Phase: Preclinical

Molecular Formula: C11H9ClN6

Molecular Weight: 260.69

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nc(Cl)nc2c1ncn2Cc1ccccn1

Standard InChI:  InChI=1S/C11H9ClN6/c12-11-16-9(13)8-10(17-11)18(6-15-8)5-7-3-1-2-4-14-7/h1-4,6H,5H2,(H2,13,16,17)

Standard InChI Key:  OAJBEJALFJRACU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 18 20  0  0  0  0  0  0  0  0999 V2000
    6.5335   -3.3760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0145   -4.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5352   -4.6984    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7577   -4.4489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0532   -4.8542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3436   -4.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3426   -3.6294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0511   -3.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7566   -3.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0501   -2.4027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7909   -5.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5895   -5.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1366   -5.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9352   -5.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1867   -5.9846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6396   -6.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8410   -6.4220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6350   -4.8560    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  1  9  1  0
  4  9  1  0
  8 10  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 12 17  2  0
 11 12  1  0
  3 11  1  0
  6 18  1  0
M  END

Alternative Forms

Associated Targets(Human)

PDE8A Tclin Phosphodiesterase 8A (260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 260.69Molecular Weight (Monoisotopic): 260.0577AlogP: 1.51#Rotatable Bonds: 2
Polar Surface Area: 82.51Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.85CX LogP: 1.19CX LogD: 1.19
Aromatic Rings: 3Heavy Atoms: 18QED Weighted: 0.71Np Likeness Score: -1.50

References

1. Huang Y,Wu XN,Zhou Q,Wu Y,Zheng D,Li Z,Guo L,Luo HB.  (2020)  Rational Design of 2-Chloroadenine Derivatives as Highly Selective Phosphodiesterase 8A Inhibitors.,  63  (24): [PMID:33291877] [10.1021/acs.jmedchem.0c01573]

Source