5-hydroxy-2-[3-[3-(trifluoromethyl)phenyl]propyl]chromen-4-one

ID: ALA4780527

PubChem CID: 162663486

Max Phase: Preclinical

Molecular Formula: C19H15F3O3

Molecular Weight: 348.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=c1cc(CCCc2cccc(C(F)(F)F)c2)oc2cccc(O)c12

Standard InChI:  InChI=1S/C19H15F3O3/c20-19(21,22)13-6-1-4-12(10-13)5-2-7-14-11-16(24)18-15(23)8-3-9-17(18)25-14/h1,3-4,6,8-11,23H,2,5,7H2

Standard InChI Key:  HQPBWIOELMTRIZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   23.4000   -3.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3988   -4.8105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1069   -5.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1051   -3.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8137   -3.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8125   -4.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5226   -5.2239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2384   -4.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2396   -3.9894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5250   -3.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5250   -2.7563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1026   -2.7649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9450   -5.2252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6539   -4.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3604   -5.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0693   -4.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7730   -5.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4814   -4.8302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4841   -4.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7726   -3.6017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0672   -4.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1877   -5.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1850   -6.0583    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.8968   -4.8349    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.8911   -5.6460    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
  4 12  1  0
  8 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 18 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4780527

    ---

Associated Targets(Human)

HTR2B Tclin Serotonin 2b (5-HT2b) receptor (10323 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HTR2C Tclin Serotonin 2c (5-HT2c) receptor (11471 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HTR2A Tclin Serotonin 2a (5-HT2a) receptor (14758 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.32Molecular Weight (Monoisotopic): 348.0973AlogP: 4.69#Rotatable Bonds: 4
Polar Surface Area: 50.44Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.46CX Basic pKa: CX LogP: 5.64CX LogD: 5.37
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.74Np Likeness Score: 0.24

References

1. Kim M,Truss M,Pagare PP,Essandoh MA,Zhang Y,Williams DA.  (2020)  Structure activity relationship exploration of 5-hydroxy-2-(3-phenylpropyl)chromones as a unique 5-HT receptor antagonist scaffold.,  30  (21.0): [PMID:32853682] [10.1016/j.bmcl.2020.127511]

Source