N-(3-(diethylamino)propyl)-1-ethyl-5-(3-(4-(2-hydroxy-2-phenylethoxy)-3-methylphenyl)pentan-3-yl)-1H-pyrrole-2-carboxamide

ID: ALA4780535

PubChem CID: 162663492

Max Phase: Preclinical

Molecular Formula: C34H49N3O3

Molecular Weight: 547.78

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCCNC(=O)c1ccc(C(CC)(CC)c2ccc(OCC(O)c3ccccc3)c(C)c2)n1CC

Standard InChI:  InChI=1S/C34H49N3O3/c1-7-34(8-2,28-18-20-31(26(6)24-28)40-25-30(38)27-16-13-12-14-17-27)32-21-19-29(37(32)11-5)33(39)35-22-15-23-36(9-3)10-4/h12-14,16-21,24,30,38H,7-11,15,22-23,25H2,1-6H3,(H,35,39)

Standard InChI Key:  BBOYAMSKXNEOTE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 42  0  0  0  0  0  0  0  0999 V2000
   35.3149   -9.7290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3137  -10.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0285  -10.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7449  -10.5559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7421   -9.7253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0267   -9.3163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0283  -11.7942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5989  -10.9683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.4550   -9.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1710   -9.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2640  -10.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0716  -10.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4815   -9.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9270   -9.3806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.3035   -9.9020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7909  -10.5675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.6362   -9.1471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.8662   -8.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0371   -8.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9069   -7.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9624   -7.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4562   -9.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7890   -8.3027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6090   -8.2132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9417   -7.4583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.7618   -7.3690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4543   -6.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7869   -6.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0945   -6.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8848  -10.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1700  -10.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4558  -10.5541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1693  -11.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4533  -12.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4523  -13.0272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1670  -13.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8841  -13.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8816  -12.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0957   -8.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8794   -8.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  2  8  1  0
  5  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
 15 16  2  0
 15 17  1  0
 13 15  1  0
  9 18  1  0
  9 19  1  0
 19 20  1  0
 18 21  1  0
 17 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 26 29  1  0
  8 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 14 39  1  0
 39 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4780535

    ---

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 547.78Molecular Weight (Monoisotopic): 547.3774AlogP: 6.50#Rotatable Bonds: 16
Polar Surface Area: 66.73Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.67CX Basic pKa: 9.84CX LogP: 6.36CX LogD: 3.95
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.20Np Likeness Score: -0.94

References

1. Kang Z,Wang C,Tong Y,Li Y,Gao Y,Hou S,Hao M,Han X,Wang B,Wang Q,Zhang C.  (2021)  Novel Nonsecosteroidal Vitamin D Receptor Modulator Combined with Gemcitabine Enhances Pancreatic Cancer Therapy through Remodeling of the Tumor Microenvironment.,  64  (1.0): [PMID:33381963] [10.1021/acs.jmedchem.0c01197]

Source