The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4S)-4-nitrophenethyl 1-(2-chlorobenzyl)-4-(4-methoxybenzylamino)pyrrolidine-2-carboxylate ID: ALA4780551
PubChem CID: 162663612
Max Phase: Preclinical
Molecular Formula: C28H30ClN3O5
Molecular Weight: 524.02
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CN[C@H]2C[C@@H](C(=O)OCCc3ccc([N+](=O)[O-])cc3)N(Cc3ccccc3Cl)C2)cc1
Standard InChI: InChI=1S/C28H30ClN3O5/c1-36-25-12-8-21(9-13-25)17-30-23-16-27(31(19-23)18-22-4-2-3-5-26(22)29)28(33)37-15-14-20-6-10-24(11-7-20)32(34)35/h2-13,23,27,30H,14-19H2,1H3/t23-,27-/m0/s1
Standard InChI Key: HOWXFCDKOQOSKZ-HOFKKMOUSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
10.3033 -11.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1283 -11.3366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3851 -10.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7158 -10.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0509 -10.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2662 -10.2980 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0943 -9.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3096 -9.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1430 -8.4317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3591 -8.1770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7453 -8.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9207 -9.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7043 -9.7908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9603 -8.4760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7873 -7.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6124 -12.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2760 -12.7579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4544 -12.8385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1180 -13.5910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6023 -14.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4267 -14.1716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7594 -13.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1734 -10.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7857 -10.8497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3460 -9.4901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5706 -10.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1829 -11.1487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9677 -10.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5795 -13.3304 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.9877 -9.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1834 -10.0903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5567 -11.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3611 -11.2682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5766 -10.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3811 -10.2481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5966 -9.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9700 -10.8371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
5 6 1 1
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 1 0
2 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
23 24 1 0
23 25 2 0
3 23 1 1
24 26 1 0
26 27 1 0
27 28 1 0
22 29 1 0
31 28 2 0
28 32 1 0
30 31 1 0
32 33 2 0
33 34 1 0
30 34 2 0
34 35 1 0
35 36 2 0
35 37 1 0
M CHG 2 35 1 37 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.02Molecular Weight (Monoisotopic): 523.1874AlogP: 4.78#Rotatable Bonds: 11Polar Surface Area: 93.94Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.39CX LogP: 5.46CX LogD: 4.43Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.22Np Likeness Score: -1.19
References 1. Nguyen T,Marusich J,Li JX,Zhang Y. (2020) Neuropeptide FF and Its Receptors: Therapeutic Applications and Ligand Development., 63 (21.0): [PMID:32673481 ] [10.1021/acs.jmedchem.0c00643 ]