1-(2-methyl-5-nitro-1H-imidazol-1-yl)propan-2-yl 4-fluorophenylcarbamate

ID: ALA4780569

PubChem CID: 162663887

Max Phase: Preclinical

Molecular Formula: C14H15FN4O4

Molecular Weight: 322.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ncc([N+](=O)[O-])n1CC(C)OC(=O)Nc1ccc(F)cc1

Standard InChI:  InChI=1S/C14H15FN4O4/c1-9(8-18-10(2)16-7-13(18)19(21)22)23-14(20)17-12-5-3-11(15)4-6-12/h3-7,9H,8H2,1-2H3,(H,17,20)

Standard InChI Key:  KTVWRIOEOXFNEK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
   11.4578  -10.4913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2828  -10.4913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5396   -9.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8703   -9.2205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2054   -9.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3247   -9.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9727  -11.1598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3072  -11.9139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1523  -11.0726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7670  -11.1593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5875  -11.0740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0717  -11.7420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8922  -11.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3764  -12.3247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2286  -10.9035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1969  -12.2394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6770  -12.9083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4942  -12.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8347  -12.0736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3515  -11.4036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5281  -11.4855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9271  -10.3136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6634  -11.9906    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  3  6  1  0
  7  8  2  0
  7  9  1  0
  1  7  1  0
  2 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 16 21  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 11 22  1  0
 19 23  1  0
M  CHG  2   7   1   9  -1
M  END

Alternative Forms

  1. Parent:

    ALA4780569

    ---

Associated Targets(non-human)

Giardia intestinalis (1290 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.30Molecular Weight (Monoisotopic): 322.1077AlogP: 2.88#Rotatable Bonds: 5
Polar Surface Area: 99.29Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.15CX Basic pKa: 3.27CX LogP: 2.45CX LogD: 2.45
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.67Np Likeness Score: -1.72

References

1. Riches A,Hart CJS,Trenholme KR,Skinner-Adams TS.  (2020)  Anti-Giardia Drug Discovery: Current Status and Gut Feelings.,  63  (22.0): [PMID:32869995] [10.1021/acs.jmedchem.0c00910]

Source