The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1R,3R)-methyl 1-(4-(methoxycarbonyl)phenyl)-2-(5-methyl-4-nitroisoxazole-3-carbonyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate ID: ALA4780613
PubChem CID: 162663312
Max Phase: Preclinical
Molecular Formula: C26H22N4O8
Molecular Weight: 518.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc([C@@H]2c3[nH]c4ccccc4c3C[C@H](C(=O)OC)N2C(=O)c2noc(C)c2[N+](=O)[O-])cc1
Standard InChI: InChI=1S/C26H22N4O8/c1-13-22(30(34)35)21(28-38-13)24(31)29-19(26(33)37-3)12-17-16-6-4-5-7-18(16)27-20(17)23(29)14-8-10-15(11-9-14)25(32)36-2/h4-11,19,23,27H,12H2,1-3H3/t19-,23-/m1/s1
Standard InChI Key: DVJHBYSSZLZVAO-AUSIDOKSSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
1.7404 -14.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7392 -15.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4541 -15.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4523 -14.1843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1678 -14.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1680 -15.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9585 -15.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9581 -14.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4470 -15.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2701 -14.9238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6109 -14.1652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1220 -13.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2924 -13.5768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4587 -12.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4315 -14.0805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2794 -12.6535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9747 -12.0702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1541 -12.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0131 -14.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7083 -13.3033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8830 -15.4770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6165 -15.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1997 -15.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8268 -14.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2016 -13.7998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7533 -13.1073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0256 -13.7578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0144 -15.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6755 -15.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2596 -16.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6643 -17.0511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4835 -17.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8963 -16.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4892 -15.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8931 -17.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4778 -18.4849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7182 -17.7753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1279 -18.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 1 6
11 15 1 0
14 16 2 0
14 17 1 0
17 18 1 0
15 19 1 0
15 20 2 0
19 21 2 0
21 22 1 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 2 0
25 27 1 0
24 25 1 0
23 28 1 0
10 29 1 6
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
35 36 2 0
35 37 1 0
37 38 1 0
M CHG 2 25 1 27 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.48Molecular Weight (Monoisotopic): 518.1438AlogP: 3.49#Rotatable Bonds: 5Polar Surface Area: 157.87Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.57CX LogD: 3.57Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -0.65
References 1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL. (2020) Structure-activity relationships of GPX4 inhibitor warheads., 30 (23.0): [PMID:32920142 ] [10.1016/j.bmcl.2020.127538 ]