The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3R,5S)-5-(4-(7-(methylsulfonyl)-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-ylamino)piperidin-3-yl)propionamide ID: ALA4780631
PubChem CID: 145444269
Max Phase: Preclinical
Molecular Formula: C22H25F3N6O3S
Molecular Weight: 510.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)N[C@H]1CNC[C@@H](Nc2ncc(C(F)(F)F)c(-c3c[nH]c4c(S(C)(=O)=O)cccc34)n2)C1
Standard InChI: InChI=1S/C22H25F3N6O3S/c1-3-18(32)29-12-7-13(9-26-8-12)30-21-28-11-16(22(23,24)25)19(31-21)15-10-27-20-14(15)5-4-6-17(20)35(2,33)34/h4-6,10-13,26-27H,3,7-9H2,1-2H3,(H,29,32)(H,28,30,31)/t12-,13+/m1/s1
Standard InChI Key: OFVNWSJOGCICRX-OLZOCXBDSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
38.1036 -1.7083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9286 -1.7083 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.5161 -0.9939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2230 -2.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2218 -3.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9366 -4.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9348 -2.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6502 -2.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6550 -3.7728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4425 -4.0235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9244 -3.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4347 -2.6864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.7007 -4.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1505 -5.4182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4093 -6.2007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2181 -6.3682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.7674 -5.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5056 -4.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8607 -6.8167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.1197 -7.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5659 -8.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8220 -8.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6293 -9.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1802 -8.5491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9238 -7.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0524 -4.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8607 -4.5137 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.4619 -3.7583 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.2619 -3.5458 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.2697 -9.6107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6455 -1.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4621 -9.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9122 -10.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2045 -8.6582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1047 -9.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
10 13 1 0
15 19 1 0
20 19 1 6
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
18 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
22 30 1 6
7 2 1 0
2 31 1 0
30 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.54Molecular Weight (Monoisotopic): 510.1661AlogP: 2.72#Rotatable Bonds: 6Polar Surface Area: 128.87Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.73CX Basic pKa: 8.59CX LogP: 1.42CX LogD: 0.20Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -1.07
References 1. (2019) Inhibitors of cyclin-dependent kinase 7 (cdk7),