4-Amino-2-((4,4-bis(3-methylthiophen-2-yl)but-3-en-1-yl)(methyl)amino)-N-(2-chlorobenzyl)butanamide

ID: ALA4780692

PubChem CID: 162662862

Max Phase: Preclinical

Molecular Formula: C26H32ClN3OS2

Molecular Weight: 502.15

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccsc1C(=CCCN(C)C(CCN)C(=O)NCc1ccccc1Cl)c1sccc1C

Standard InChI:  InChI=1S/C26H32ClN3OS2/c1-18-11-15-32-24(18)21(25-19(2)12-16-33-25)8-6-14-30(3)23(10-13-28)26(31)29-17-20-7-4-5-9-22(20)27/h4-5,7-9,11-12,15-16,23H,6,10,13-14,17,28H2,1-3H3,(H,29,31)

Standard InChI Key:  QKKGISPNJFYJKR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    2.6332   -3.9707    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.4582   -3.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7149   -3.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0457   -2.6999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3806   -3.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9423   -4.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7628   -4.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6059   -5.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7999   -5.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7128   -6.3785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4661   -6.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0187   -6.1024    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.4999   -2.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1888   -5.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2470   -5.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0675   -5.1361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5517   -5.8041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3722   -5.7188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2152   -6.5573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8564   -6.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7086   -4.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5292   -4.8803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2245   -4.2976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5199   -7.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0041   -7.8080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6884   -4.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8648   -4.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1670   -4.7216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9897   -4.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3313   -3.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8440   -3.2112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0229   -3.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5384   -2.6283    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  2  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
  3 13  1  0
  9 14  1  0
  7 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 18 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  2  0
 20 24  1  0
 24 25  1  0
 22 27  1  0
 26 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 26  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4780692

    ---

Associated Targets(non-human)

Slc6a11 GABA transporter 4 (930 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a13 GABA transporter 3 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a1 GABA transporter 1 (1980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.15Molecular Weight (Monoisotopic): 501.1675AlogP: 5.87#Rotatable Bonds: 11
Polar Surface Area: 58.36Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.99CX Basic pKa: 9.66CX LogP: 5.80CX LogD: 3.44
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: -0.83

References

1. Zaręba P,Gryzło B,Malawska K,Sałat K,Höfner GC,Nowaczyk A,Fijałkowski Ł,Rapacz A,Podkowa A,Furgała A,Żmudzki P,Wanner KT,Malawska B,Kulig K.  (2020)  Novel mouse GABA uptake inhibitors with enhanced inhibitory activity toward mGAT3/4 and their effect on pain threshold in mice.,  188  [PMID:31901745] [10.1016/j.ejmech.2019.111920]

Source