N-(3-chloro-4-methoxyphenyl)-N-(2-oxo-2-(phenethylamino)-1-(thiophen-2-yl)ethyl)-3-(triethylsilyl)propiolamide

ID: ALA4780750

PubChem CID: 162663402

Max Phase: Preclinical

Molecular Formula: C30H35ClN2O3SSi

Molecular Weight: 567.23

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[Si](C#CC(=O)N(c1ccc(OC)c(Cl)c1)C(C(=O)NCCc1ccccc1)c1cccs1)(CC)CC

Standard InChI:  InChI=1S/C30H35ClN2O3SSi/c1-5-38(6-2,7-3)21-18-28(34)33(24-15-16-26(36-4)25(31)22-24)29(27-14-11-20-37-27)30(35)32-19-17-23-12-9-8-10-13-23/h8-16,20,22,29H,5-7,17,19H2,1-4H3,(H,32,35)

Standard InChI Key:  GEVDAHDMRKQNIT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
   30.8394   -4.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8382   -5.7108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5499   -6.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2674   -5.7103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2646   -4.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5481   -4.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5457   -3.6422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.2600   -3.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2575   -2.4038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9767   -3.6380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8330   -3.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8306   -2.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9836   -6.1199    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   31.5497   -6.9475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8382   -7.3621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1187   -3.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1213   -4.4719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4020   -3.2379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.6878   -3.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9710   -3.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2567   -3.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5405   -3.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8267   -3.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8287   -4.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5504   -4.8943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2613   -4.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4931   -1.9226    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.2370   -1.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4113   -1.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1600   -1.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6922   -4.0451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4110   -4.4501    0.0000 Si  0  0  0  0  0  4  0  0  0  0  0  0
   34.4195   -5.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1179   -4.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1180   -4.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8292   -4.4470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1093   -3.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1352   -5.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
  7 11  1  0
 11 12  1  0
  4 13  1  0
  3 14  1  0
 14 15  1  0
 11 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 12 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 12  2  0
 10 31  3  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
 35 36  1  0
 34 37  1  0
 33 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4780750

    ---

Associated Targets(Human)

GPX4 Tchem Phospholipid hydroperoxide glutathione peroxidase (167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 567.23Molecular Weight (Monoisotopic): 566.1826AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Eaton JK,Furst L,Cai LL,Viswanathan VS,Schreiber SL.  (2020)  Structure-activity relationships of GPX4 inhibitor warheads.,  30  (23.0): [PMID:32920142] [10.1016/j.bmcl.2020.127538]

Source