The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((1R,3R)-3-(5-chloro-4-(1H-indol-3-yl)pyrimidin-2-ylamino)cyclohexyloxy)phenyl)acrylamide ID: ALA4780821
PubChem CID: 134560480
Max Phase: Preclinical
Molecular Formula: C27H26ClN5O2
Molecular Weight: 487.99
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1ccc(O[C@@H]2CCC[C@@H](Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)C2)cc1
Standard InChI: InChI=1S/C27H26ClN5O2/c1-2-25(34)31-17-10-12-19(13-11-17)35-20-7-5-6-18(14-20)32-27-30-16-23(28)26(33-27)22-15-29-24-9-4-3-8-21(22)24/h2-4,8-13,15-16,18,20,29H,1,5-7,14H2,(H,31,34)(H,30,32,33)/t18-,20-/m1/s1
Standard InChI Key: TWMKLBGOEVXSBH-UYAOXDASSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
5.2264 -10.5543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9392 -10.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6524 -10.5537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6524 -11.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9418 -11.7881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2264 -11.3799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5135 -11.7946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5135 -12.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7102 -12.8688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2374 -12.2138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7280 -11.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3970 -10.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5734 -10.6989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0841 -11.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4175 -12.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3653 -11.7892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0782 -11.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0782 -10.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7952 -10.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5081 -10.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5081 -11.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7953 -11.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2211 -11.7892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9340 -11.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9343 -10.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6489 -10.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3621 -10.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3643 -11.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6513 -11.7918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0750 -10.1419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7879 -10.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5050 -10.1419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2179 -10.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7879 -11.3817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5135 -10.1397 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
7 6 1 0
7 8 2 0
8 9 1 0
9 10 1 0
11 10 2 0
7 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
10 15 1 0
4 16 1 0
17 16 1 6
18 17 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
17 22 1 0
21 23 1 1
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
27 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
31 34 2 0
1 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.99Molecular Weight (Monoisotopic): 487.1775AlogP: 6.20#Rotatable Bonds: 7Polar Surface Area: 91.93Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.01CX LogP: 5.61CX LogD: 5.61Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -0.48
References 1. (2020) Inhibitors of cyclin-dependent kinase 12 (cdk12) and uses thereof,