The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(hydroxyamino)-2-oxoethyl)-4-((4-(morpholinomethyl)phenyl)ethynyl)benzamide ID: ALA4780842
PubChem CID: 162663406
Max Phase: Preclinical
Molecular Formula: C22H23N3O4
Molecular Weight: 393.44
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNC(=O)c1ccc(C#Cc2ccc(CN3CCOCC3)cc2)cc1)NO
Standard InChI: InChI=1S/C22H23N3O4/c26-21(24-28)15-23-22(27)20-9-7-18(8-10-20)2-1-17-3-5-19(6-4-17)16-25-11-13-29-14-12-25/h3-10,28H,11-16H2,(H,23,27)(H,24,26)
Standard InChI Key: KKQPPDLVGMTMLX-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
23.0281 -2.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0269 -3.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7418 -3.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7400 -2.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3121 -3.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5920 -4.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8736 -4.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1661 -4.3529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4482 -4.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4397 -5.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1553 -6.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8703 -5.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7219 -5.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0109 -5.5718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0175 -4.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3106 -4.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5903 -4.7316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5815 -5.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2930 -5.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4554 -2.7214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4602 -3.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1678 -2.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8843 -2.7142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1637 -1.4803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5968 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3133 -2.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0257 -2.2911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3174 -3.5322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7422 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 21 1 0
20 4 1 0
4 1 2 0
2 5 1 0
5 6 3 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 21 2 0
20 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.44Molecular Weight (Monoisotopic): 393.1689AlogP: 1.15#Rotatable Bonds: 5Polar Surface Area: 90.90Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.76CX Basic pKa: 6.77CX LogP: 1.46CX LogD: 1.45Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.40Np Likeness Score: -1.23
References 1. Furuya T,Shapiro AB,Comita-Prevoir J,Kuenstner EJ,Zhang J,Ribe SD,Chen A,Hines D,Moussa SH,Carter NM,Sylvester MA,Romero JAC,Vega CV,Sacco MD,Chen Y,O'Donnell JP,Durand-Reville TF,Miller AA,Tommasi RA. (2020) N-Hydroxyformamide LpxC inhibitors, their in vivo efficacy in a mouse Escherichia coli infection model, and their safety in a rat hemodynamic assay., 28 (24): [PMID:33160146 ] [10.1016/j.bmc.2020.115826 ]