3,5-dichloro-2-hydroxy-N-(3-methyl-4-phenoxy-phenyl)benzamide

ID: ALA4781027

PubChem CID: 162663636

Max Phase: Preclinical

Molecular Formula: C20H15Cl2NO3

Molecular Weight: 388.25

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(NC(=O)c2cc(Cl)cc(Cl)c2O)ccc1Oc1ccccc1

Standard InChI:  InChI=1S/C20H15Cl2NO3/c1-12-9-14(7-8-18(12)26-15-5-3-2-4-6-15)23-20(25)16-10-13(21)11-17(22)19(16)24/h2-11,24H,1H3,(H,23,25)

Standard InChI Key:  MNFXCIMOHFBBHM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   28.6514  -12.7044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3597  -12.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3550  -11.4632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6459  -11.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0731  -12.6994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7834  -12.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4940  -12.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2037  -12.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2010  -11.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4826  -11.0557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7758  -11.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9107  -11.0491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6246  -11.4540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3343  -11.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6289  -12.2753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0426  -11.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7518  -11.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7480  -10.2150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0290   -9.8062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3269  -10.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6114   -9.8180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0219   -8.9849    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   36.4656  -11.4424    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   27.9360  -12.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9414  -11.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4943  -13.5155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 24  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 25  1  0
  2  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 14  1  0
 20 21  1  0
 19 22  1  0
 17 23  1  0
 24 25  2  0
  7 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4781027

    ---

Associated Targets(Human)

STK39 Tchem STE20/SPS1-related proline-alanine-rich protein kinase (342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 388.25Molecular Weight (Monoisotopic): 387.0429AlogP: 6.05#Rotatable Bonds: 4
Polar Surface Area: 58.56Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.95CX Basic pKa: CX LogP: 5.98CX LogD: 4.62
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.57Np Likeness Score: -1.29

References

1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H.  (2020)  Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling.,  30  (17): [PMID:32738993] [10.1016/j.bmcl.2020.127408]

Source