trans-3-Undecyl-1-oxo-isochroman-4-carboxylic acid

ID: ALA478136

PubChem CID: 44582428

Max Phase: Preclinical

Molecular Formula: C21H30O4

Molecular Weight: 346.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCC[C@@H]1OC(=O)c2ccccc2[C@H]1C(=O)O

Standard InChI:  InChI=1S/C21H30O4/c1-2-3-4-5-6-7-8-9-10-15-18-19(20(22)23)16-13-11-12-14-17(16)21(24)25-18/h11-14,18-19H,2-10,15H2,1H3,(H,22,23)/t18-,19+/m0/s1

Standard InChI Key:  OQSBKJDEQGTFDX-RBUKOAKNSA-N

Molfile:  

     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
    6.6277   -4.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6266   -4.9440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3414   -5.3569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3396   -3.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0541   -4.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0598   -4.9394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7749   -5.3457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4888   -4.9295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4831   -4.1026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7634   -3.6918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7795   -6.1707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7566   -2.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4666   -2.4477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0377   -2.4596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1951   -3.6858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120   -4.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6240   -3.6774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3409   -4.0856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0529   -3.6689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7698   -4.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4819   -3.6605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1988   -4.0687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9108   -3.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6277   -4.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3397   -3.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10 12  1  1
  2  3  1  0
  3  6  2  0
 12 13  1  0
 12 14  2  0
  1  2  2  0
  9 15  1  6
  5  4  2  0
 15 16  1  0
  4  1  1  0
 16 17  1  0
  5 10  1  0
 17 18  1  0
  6  7  1  0
 18 19  1  0
  7  8  1  0
 19 20  1  0
  8  9  1  0
 20 21  1  0
  9 10  1  0
 21 22  1  0
  5  6  1  0
 22 23  1  0
  7 11  2  0
 23 24  1  0
 24 25  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Fasn Fatty acid synthase (89 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 346.47Molecular Weight (Monoisotopic): 346.2144AlogP: 5.31#Rotatable Bonds: 11
Polar Surface Area: 63.60Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.97CX Basic pKa: CX LogP: 6.14CX LogD: 2.96
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.44Np Likeness Score: 0.65

References

1. Wang X, Lin J, Chen Y, Zhong W, Zhao G, Liu H, Li S, Wang L, Li S..  (2009)  Novel fatty acid synthase (FAS) inhibitors: design, synthesis, biological evaluation, and molecular docking studies.,  17  (5): [PMID:19223187] [10.1016/j.bmc.2009.01.050]

Source