(5H-Dibenzo[b,f]azepin-5-yl)(4-(3-(dimethylamino)propoxy)phenyl)methanone

ID: ALA4781385

PubChem CID: 162664970

Max Phase: Preclinical

Molecular Formula: C26H26N2O2

Molecular Weight: 398.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCCOc1ccc(C(=O)N2c3ccccc3C=Cc3ccccc32)cc1

Standard InChI:  InChI=1S/C26H26N2O2/c1-27(2)18-7-19-30-23-16-14-22(15-17-23)26(29)28-24-10-5-3-8-20(24)12-13-21-9-4-6-11-25(21)28/h3-6,8-17H,7,18-19H2,1-2H3

Standard InChI Key:  CXRYGXQLDCNCCK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   20.4985   -4.2840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4974   -5.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2054   -5.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9151   -5.1031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9123   -4.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2036   -3.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6234   -5.5106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3305   -5.1009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0389   -5.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7459   -5.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4543   -5.5061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7907   -3.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0831   -4.2844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7905   -3.0584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4555   -6.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1613   -5.0964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3792   -1.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1953   -1.2633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7087   -1.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5257   -2.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1269   -3.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9113   -3.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0911   -2.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4885   -1.6572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0588   -2.6999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8744   -1.9035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0941   -1.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4974   -2.2247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6863   -3.0232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4663   -3.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  1 12  1  0
 12 13  2  0
 12 14  1  0
 11 15  1  0
 11 16  1  0
 14 25  1  0
 14 20  1  0
 26 17  1  0
 17 18  2  0
 19 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4781385

    ---

Associated Targets(Human)

CACNA1B Tclin Voltage-gated N-type calcium channel alpha-1B subunit (743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1H Tclin Voltage-gated T-type calcium channel alpha-1H subunit (1913 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.51Molecular Weight (Monoisotopic): 398.1994AlogP: 5.48#Rotatable Bonds: 6
Polar Surface Area: 32.78Molecular Species: BASEHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.26CX LogP: 4.87CX LogD: 3.02
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: -0.64

References

1. Cardoso FC,Marliac MA,Geoffroy C,Schmit M,Bispat A,Lewis RJ,Tuck KL,Duggan PJ.  (2020)  The neuronal calcium ion channel activity of constrained analogues of MONIRO-1.,  28  (18): [PMID:32828422] [10.1016/j.bmc.2020.115655]

Source