Rhamnoneuronal A

ID: ALA4781523

PubChem CID: 162665065

Max Phase: Preclinical

Molecular Formula: C29H22O9

Molecular Weight: 514.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1c2c(cc(O)c3c2O[C@H](c2ccc(O)cc2)[C@H]3c2cc(O)cc(O)c2)O[C@@H](c2ccc(O)cc2)[C@@H]1O

Standard InChI:  InChI=1S/C29H22O9/c30-16-5-1-13(2-6-16)27-22(15-9-18(32)11-19(33)10-15)23-20(34)12-21-24(29(23)38-27)25(35)26(36)28(37-21)14-3-7-17(31)8-4-14/h1-12,22,26-28,30-34,36H/t22-,26+,27+,28-/m0/s1

Standard InChI Key:  RRVCVXBEHJRBPZ-AXCRSINUSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
    5.5637   -3.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2760   -2.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9896   -3.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9877   -4.1757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7017   -4.5890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4202   -4.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4220   -3.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7053   -2.9275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1369   -2.9381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8522   -3.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5651   -2.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5687   -2.1202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8505   -1.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1380   -2.1178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2746   -4.5886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5623   -4.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9493   -4.7347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2896   -5.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1059   -5.3981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1457   -4.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8865   -3.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0805   -3.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5283   -4.2270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7905   -5.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5956   -5.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8768   -6.2002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0496   -6.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6401   -6.9145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0561   -7.6305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8839   -7.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2919   -6.9092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6982   -5.4145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1347   -4.5902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2857   -1.7087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2431   -5.6297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8246   -2.8231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6480   -8.3452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8487   -2.9377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1 16  2  0
 15  4  2  0
  3  2  2  0
  2  1  1  0
  3  4  1  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  7  9  1  1
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  1
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 18 26  1  6
  5 32  2  0
  6 33  1  6
 12 34  1  0
 24 35  1  0
 22 36  1  0
 29 37  1  0
  1 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4781523

    ---

Associated Targets(Human)

NHDF (1164 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 514.49Molecular Weight (Monoisotopic): 514.1264AlogP: 4.16#Rotatable Bonds: 3
Polar Surface Area: 156.91Molecular Species: NEUTRALHBA: 9HBD: 6
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.88CX Basic pKa: CX LogP: 4.03CX LogD: 3.90
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: 1.69

References

1. Cho HM,Lee YR,Lee BW,Zhang M,Ryu B,Nghiem DT,Pham HT,Oh WK.  (2020)  Phenolic Constituents of the Roots of Rhamnoneuron balansae with Senolytic Activity.,  83  (12): [PMID:33256407] [10.1021/acs.jnatprod.0c00885]

Source