The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-((4-Bromophenyl)sulfonyl)piperazin-1-yl)(1-(4-fluorobenzyl)-1H-1,2,3-triazol-4-yl)methanone ID: ALA4781556
PubChem CID: 162664239
Max Phase: Preclinical
Molecular Formula: C20H19BrFN5O3S
Molecular Weight: 508.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1cn(Cc2ccc(F)cc2)nn1)N1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1
Standard InChI: InChI=1S/C20H19BrFN5O3S/c21-16-3-7-18(8-4-16)31(29,30)27-11-9-25(10-12-27)20(28)19-14-26(24-23-19)13-15-1-5-17(22)6-2-15/h1-8,14H,9-13H2
Standard InChI Key: WPCXHEFFPPPOBZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
29.3652 -17.8915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9608 -17.1817 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.5477 -17.8889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6748 -15.9476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6748 -16.7689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3842 -17.1775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0895 -16.7689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0895 -15.9476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3842 -15.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8025 -15.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5131 -15.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8049 -14.7198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5958 -16.7656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3988 -16.9419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8136 -16.2313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2644 -15.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6316 -16.2283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0428 -16.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6318 -17.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0423 -18.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8645 -18.3530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2745 -17.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8575 -16.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2511 -16.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2529 -15.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5413 -15.5432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8291 -15.9528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8329 -16.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5451 -17.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2760 -19.0590 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.1208 -15.5453 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 11 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
5 2 1 0
2 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
21 30 1 0
27 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.37Molecular Weight (Monoisotopic): 507.0376AlogP: 2.37#Rotatable Bonds: 5Polar Surface Area: 88.40Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.02CX LogD: 3.02Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -2.49
References 1. Manasa, Kesari Lakshmi, Thatikonda, Sowjanya, Sigalapalli, Dilep Kumar, Vuppaladadium, Sowmya, Devi, Ganthala Parimala, Godugu, Chandraiah, Alvala, Mallika, Nagesh, Narayana, Babu, Bathini Nagendra. (2020) Design and synthesis of substituted (1-(benzyl)-1H-1,2,3-triazol-4-yl)(piperazin-1-yl)methanone conjugates: study on their apoptosis inducing ability and tubulin polymerization inhibition, 11 (11): [PMID:34095841 ] [10.1039/d0md00162g ]