N-Allyl-6-nitro-1H-benzo[d]imidazol-2-amine

ID: ALA4781564

PubChem CID: 78911156

Max Phase: Preclinical

Molecular Formula: C10H10N4O2

Molecular Weight: 218.22

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CCNc1nc2ccc([N+](=O)[O-])cc2[nH]1

Standard InChI:  InChI=1S/C10H10N4O2/c1-2-5-11-10-12-8-4-3-7(14(15)16)6-9(8)13-10/h2-4,6H,1,5H2,(H2,11,12,13)

Standard InChI Key:  PQXRSKGMWYLVNT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 16 17  0  0  0  0  0  0  0  0999 V2000
   21.5511   -6.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5500   -7.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2647   -8.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2629   -6.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9783   -6.9249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9785   -7.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7690   -8.0126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2572   -7.3400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7686   -6.6680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0814   -7.3426    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4960   -6.6295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8359   -6.5166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1216   -6.9292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8357   -5.6917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3209   -6.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7356   -5.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 12 13  2  0
 12 14  1  0
  1 12  1  0
 11 15  1  0
 15 16  2  0
M  CHG  2  12   1  14  -1
M  END

Alternative Forms

Associated Targets(Human)

RIPK1 Tchem Receptor-interacting serine/threonine-protein kinase 1 (1548 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 218.22Molecular Weight (Monoisotopic): 218.0804AlogP: 2.07#Rotatable Bonds: 4
Polar Surface Area: 83.85Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.53CX Basic pKa: 6.16CX LogP: 2.09CX LogD: 2.06
Aromatic Rings: 2Heavy Atoms: 16QED Weighted: 0.47Np Likeness Score: -1.71

References

1. Benchekroun M,Ermolenko L,Tran MQ,Vagneux A,Nedev H,Delehouzé C,Souab M,Baratte B,Josselin B,Iorga BI,Ruchaud S,Bach S,Al-Mourabit A.  (2020)  Discovery of simplified benzazole fragments derived from the marine benzosceptrin B as necroptosis inhibitors involving the receptor interacting protein Kinase-1.,  201  [PMID:32659605] [10.1016/j.ejmech.2020.112337]

Source