2,4-difluoro-N3-(3-((4-fluorophenyl)carbamoyl)-1H-pyrazol-4-yl)-N3'-(3-morpholinopropyl)-[1,1'-biphenyl]-3,3'-dicarboxamide

ID: ALA4781622

PubChem CID: 162664821

Max Phase: Preclinical

Molecular Formula: C31H29F3N6O4

Molecular Weight: 606.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCCCN1CCOCC1)c1cccc(-c2ccc(F)c(C(=O)Nc3c[nH]nc3C(=O)Nc3ccc(F)cc3)c2F)c1

Standard InChI:  InChI=1S/C31H29F3N6O4/c32-21-5-7-22(8-6-21)37-31(43)28-25(18-36-39-28)38-30(42)26-24(33)10-9-23(27(26)34)19-3-1-4-20(17-19)29(41)35-11-2-12-40-13-15-44-16-14-40/h1,3-10,17-18H,2,11-16H2,(H,35,41)(H,36,39)(H,37,43)(H,38,42)

Standard InChI Key:  YIEUCLWKZPZZLL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 44 48  0  0  0  0  0  0  0  0999 V2000
   15.6446  -12.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5024  -15.7920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7886  -16.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6442  -12.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9301  -17.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2150  -15.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5229  -14.5071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4750  -13.4467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0735  -15.7942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0749  -13.7266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3620  -12.4882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0739  -14.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9688  -15.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1969  -11.2812    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.3569  -17.0326    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.9295  -16.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0290  -12.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1377  -15.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3610  -13.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7835  -14.5485    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.2187  -17.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0707  -14.9638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3571  -16.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0766  -13.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5218  -16.4769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7899  -17.0306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2176  -16.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3552  -14.5546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9215  -14.7998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0782  -11.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7878  -14.9650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4995  -17.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6423  -15.7947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6434  -14.9674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6919  -13.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7867  -15.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6493  -11.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5007  -16.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2419  -12.3502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1104  -17.1920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0752  -12.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3032  -17.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3661  -10.8419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0785  -16.1976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 11 41  1  0
 17 39  1  0
 18  7  1  0
 33 16  1  0
 11  1  1  0
  4 17  2  0
 13 27  1  0
 13 18  1  0
 27 42  2  0
 23  9  2  0
  9  3  1  0
 42 40  1  0
 25 13  2  0
 37  1  1  0
 30 43  1  0
 38 36  1  0
 12 10  1  0
 16  6  2  0
  2 27  1  0
 35  8  2  0
 18 29  2  0
 24 35  1  0
 21  5  2  0
 32 21  1  0
  5 16  1  0
 38 32  2  0
  9 22  1  0
  7 35  1  0
 19 11  1  0
 40 25  1  0
  3 26  2  0
 10 19  1  0
 31 12  1  0
 23 15  1  0
 36 31  1  0
 22 20  1  0
 33 23  1  0
 17 14  1  0
 39 24  2  0
  8  4  1  0
  6 38  1  0
 22 28  2  0
 43 37  1  0
 28 34  1  0
 34 33  2  0
 41 30  1  0
  3  2  1  0
 36 44  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4781622

    ---

Associated Targets(Human)

CDK1 Tchem Cyclin-dependent kinase 1/cyclin B1 (1887 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A2058 (690 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 606.61Molecular Weight (Monoisotopic): 606.2202AlogP: 4.45#Rotatable Bonds: 10
Polar Surface Area: 128.45Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.29CX Basic pKa: 6.97CX LogP: 3.86CX LogD: 3.71
Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.20Np Likeness Score: -1.73

References

1. Lin T,Li J,Liu L,Li Y,Jiang H,Chen K,Xu P,Luo C,Zhou B.  (2021)  Design, synthesis, and biological evaluation of 4-benzoylamino-1H-pyrazole-3-carboxamide derivatives as potent CDK2 inhibitors.,  215  [PMID:33611192] [10.1016/j.ejmech.2021.113281]

Source