The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl({4-[2-({1-[(2-phenyl-1H-1,3-benzodiazol-6-yl)methyl]piperidin-4-yl}oxy)phenoxymethyl]-phenyl}methyl)phosphonate ID: ALA4781632
PubChem CID: 134346167
Max Phase: Preclinical
Molecular Formula: C37H42N3O5P
Molecular Weight: 639.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(Cc1ccc(COc2ccccc2OC2CCN(Cc3ccc4nc(-c5ccccc5)[nH]c4c3)CC2)cc1)OCC
Standard InChI: InChI=1S/C37H42N3O5P/c1-3-43-46(41,44-4-2)27-29-16-14-28(15-17-29)26-42-35-12-8-9-13-36(35)45-32-20-22-40(23-21-32)25-30-18-19-33-34(24-30)39-37(38-33)31-10-6-5-7-11-31/h5-19,24,32H,3-4,20-23,25-27H2,1-2H3,(H,38,39)
Standard InChI Key: FNIICFJSJNMEBO-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
16.1925 -4.0857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3755 -4.0702 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
15.7706 -4.7855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4527 -5.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1700 -5.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1828 -4.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4820 -3.8947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7526 -5.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7647 -4.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9920 -4.0291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5022 -4.6825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9723 -5.3501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6897 -4.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2923 -3.9558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4759 -3.9433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0560 -4.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4584 -5.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2734 -5.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8705 -5.5567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5852 -5.1605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2801 -5.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9926 -5.1918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0111 -4.3745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3108 -3.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5920 -4.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7273 -3.9809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4262 -4.4044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4038 -5.2195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1019 -5.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8190 -5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8338 -4.4281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1351 -4.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1479 -3.1913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8620 -2.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5632 -3.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5485 -4.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2488 -4.4496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9638 -4.0522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9741 -3.2308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2731 -2.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6656 -4.4709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3868 -3.2531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6144 -3.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4315 -3.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5876 -4.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9827 -5.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 13 1 0
5 19 1 0
19 20 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
38 41 1 0
41 2 1 0
2 42 2 0
1 43 1 0
43 44 1 0
3 45 1 0
45 46 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 639.73Molecular Weight (Monoisotopic): 639.2862AlogP: 8.62#Rotatable Bonds: 14Polar Surface Area: 85.91Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.42CX Basic pKa: 8.31CX LogP: 6.81CX LogD: 5.85Aromatic Rings: 5Heavy Atoms: 46QED Weighted: 0.12Np Likeness Score: -0.75
References 1. Bessières M,Plebanek E,Chatterjee P,Shrivastava-Ranjan P,Flint M,Spiropoulou CF,Warszycki D,Bojarski AJ,Roy V,Agrofoglio LA. (2021) Design, synthesis and biological evaluation of 2-substituted-6-[(4-substituted-1-piperidyl)methyl]-1H-benzimidazoles as inhibitors of ebola virus infection., 214 [PMID:33548632 ] [10.1016/j.ejmech.2021.113211 ]