The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Chloro-2-((4-morpholinobutyl)amino)-N-(2-(pyrrolidin-1-yl)ethyl)quinoline-4-carboxamide ID: ALA4781713
PubChem CID: 162664303
Max Phase: Preclinical
Molecular Formula: C24H34ClN5O2
Molecular Weight: 460.02
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCN1CCCC1)c1cc(NCCCCN2CCOCC2)nc2ccc(Cl)cc12
Standard InChI: InChI=1S/C24H34ClN5O2/c25-19-5-6-22-20(17-19)21(24(31)27-8-12-29-10-3-4-11-29)18-23(28-22)26-7-1-2-9-30-13-15-32-16-14-30/h5-6,17-18H,1-4,7-16H2,(H,26,28)(H,27,31)
Standard InChI Key: QQUMHSGJRQXGAU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
12.3759 -10.6803 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0814 -10.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0825 -9.4554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3739 -9.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6684 -9.4536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9598 -9.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2544 -9.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2533 -10.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9619 -10.6785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6674 -10.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3749 -8.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6705 -7.8192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0845 -7.8210 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0856 -7.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7952 -6.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7962 -5.7748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4560 -5.2955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2023 -4.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3851 -4.5169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1336 -5.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7900 -10.6780 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7890 -11.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4975 -11.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4965 -12.7218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2009 -13.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2019 -15.5829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9074 -15.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9085 -14.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2040 -13.9485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4944 -14.3562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4934 -15.1734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5458 -9.0423 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
1 10 1 0
5 10 1 0
11 12 2 0
11 13 1 0
4 11 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
16 20 1 0
15 16 1 0
13 14 1 0
22 23 1 0
23 24 1 0
24 25 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
26 31 1 0
25 29 1 0
21 22 1 0
2 21 1 0
7 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.02Molecular Weight (Monoisotopic): 459.2401AlogP: 3.24#Rotatable Bonds: 10Polar Surface Area: 69.73Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.52CX LogP: 2.68CX LogD: 1.14Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -1.79
References 1. Baragaña B,Norcross NR,Wilson C,Porzelle A,Hallyburton I,Grimaldi R,Osuna-Cabello M,Norval S,Riley J,Stojanovski L,Simeons FR,Wyatt PG,Delves MJ,Meister S,Duffy S,Avery VM,Winzeler EA,Sinden RE,Wittlin S,Frearson JA,Gray DW,Fairlamb AH,Waterson D,Campbell SF,Willis P,Read KD,Gilbert IH. (2016) Discovery of a Quinoline-4-carboxamide Derivative with a Novel Mechanism of Action, Multistage Antimalarial Activity, and Potent in Vivo Efficacy., 59 (21): [PMID:27631715 ] [10.1021/acs.jmedchem.6b00723 ]