3-((5,7-di-tert-butylbenzofuran-2-yl)(4-methoxyphenyl)methyl)-5-nitro-1H-indole

ID: ALA4781792

PubChem CID: 162664832

Max Phase: Preclinical

Molecular Formula: C32H34N2O4

Molecular Weight: 510.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C(c2cc3cc(C(C)(C)C)cc(C(C)(C)C)c3o2)c2c[nH]c3ccc([N+](=O)[O-])cc23)cc1

Standard InChI:  InChI=1S/C32H34N2O4/c1-31(2,3)21-14-20-15-28(38-30(20)26(16-21)32(4,5)6)29(19-8-11-23(37-7)12-9-19)25-18-33-27-13-10-22(34(35)36)17-24(25)27/h8-18,29,33H,1-7H3

Standard InChI Key:  QQEKCABVSUQNHY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   14.3490   -4.1066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3478   -4.9261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0559   -5.3351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0541   -3.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7627   -4.1030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7675   -4.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5475   -5.1700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0249   -4.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5398   -3.8455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8420   -4.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2548   -5.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2465   -3.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5140   -2.4982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9101   -3.0487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8479   -5.9142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2599   -6.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0780   -6.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4822   -5.8995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0678   -5.1977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2242   -2.9027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0576   -3.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6640   -4.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4373   -3.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6007   -3.1846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9929   -2.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6411   -3.6981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6410   -2.8809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9335   -4.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9306   -3.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0569   -6.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3497   -6.5618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7651   -6.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0520   -6.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4917   -7.3194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0520   -4.5287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8276   -4.2712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8872   -5.3291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0882   -8.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 21  1  0
 20 13  1  0
 13 14  1  0
 14 12  2  0
 11 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 11  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  1 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
  3 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
 17 34  1  0
 35 36  2  0
 35 37  1  0
 23 35  1  0
 34 38  1  0
M  CHG  2  35   1  37  -1
M  END

Alternative Forms

  1. Parent:

    ALA4781792

    ---

Associated Targets(Human)

SiHa (2051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 510.63Molecular Weight (Monoisotopic): 510.2519AlogP: 8.61#Rotatable Bonds: 5
Polar Surface Area: 81.30Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 8.46CX LogD: 8.46
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.19Np Likeness Score: -0.51

References

1. Siddiqui SK,SahayaSheela VJ,Kolluru S,Pandian GN,Santhoshkumar TR,Dan VM,Ramana CV.  (2020)  Discovery of 3-(benzofuran-2-ylmethyl)-1H-indole derivatives as potential autophagy inducers in cervical cancer cells.,  30  (19): [PMID:32769048] [10.1016/j.bmcl.2020.127431]

Source