The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((2-aminonaphthalen-1-yl)diazenyl)-2-(4-(naphthalen-1-yldiazenyl)-2-sulfostyryl)benzenesulfonic acid ID: ALA4781794
PubChem CID: 162664834
Max Phase: Preclinical
Molecular Formula: C34H25N5O6S2
Molecular Weight: 663.74
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccc2ccccc2c1/N=N/c1ccc(/C=C/c2ccc(/N=N/c3cccc4ccccc34)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1
Standard InChI: InChI=1S/C34H25N5O6S2/c35-30-19-16-23-7-2-4-10-29(23)34(30)39-37-27-18-15-25(33(21-27)47(43,44)45)13-12-24-14-17-26(20-32(24)46(40,41)42)36-38-31-11-5-8-22-6-1-3-9-28(22)31/h1-21H,35H2,(H,40,41,42)(H,43,44,45)/b13-12+,38-36+,39-37+
Standard InChI Key: DGSLYKNWKLRQGK-DJOICOCKSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
10.8970 -11.4771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0706 -11.4771 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.4838 -12.1928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3812 -10.6633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2076 -10.6633 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.7944 -9.9477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6588 -14.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6575 -15.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0883 -14.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3718 -13.9767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0911 -15.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3727 -15.6303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3712 -16.4564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0873 -16.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8065 -16.4549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8045 -15.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8024 -13.9707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7993 -13.1443 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5133 -12.7284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2258 -13.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9393 -12.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9367 -11.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2145 -11.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5038 -11.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9210 -10.2451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6502 -11.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6459 -10.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3596 -10.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0734 -10.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7864 -10.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7826 -9.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0598 -9.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3497 -9.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3598 -11.8943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4956 -8.9924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4903 -8.1661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8952 -5.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1789 -5.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4690 -5.7049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4805 -6.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9030 -6.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1961 -6.9224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2024 -7.7400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9150 -8.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6226 -7.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6128 -6.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9229 -8.9704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 12 1 0
11 9 1 0
9 10 2 0
10 7 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 11 2 0
9 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
23 5 1 0
5 25 1 0
22 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
29 2 1 0
2 34 1 0
31 35 1 0
35 36 2 0
36 43 1 0
41 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 42 2 0
41 42 1 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
44 47 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 663.74Molecular Weight (Monoisotopic): 663.1246AlogP: 9.07#Rotatable Bonds: 8Polar Surface Area: 184.20Molecular Species: ACIDHBA: 9HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 3CX Acidic pKa: -2.82CX Basic pKa: 0.51CX LogP: 6.35CX LogD: 3.88Aromatic Rings: 6Heavy Atoms: 47QED Weighted: 0.06Np Likeness Score: -0.33
References 1. Wang Z,Liu Y,Zhang J,Ullah S,Kang N,Zhao Y,Zhou H. (2020) Benzothiophene-2-carboxamide derivatives as SENPs inhibitors with selectivity within SENPs family., 204 [PMID:32717481 ] [10.1016/j.ejmech.2020.112553 ]