The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((3-Chloro-4-(3-fluorophenoxy)phenyl)amino)quinazolin-6-yl)-2-(dimethylamino)acetamide ID: ALA4781812
PubChem CID: 162663928
Max Phase: Preclinical
Molecular Formula: C24H21ClFN5O2
Molecular Weight: 465.92
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CC(=O)Nc1ccc2ncnc(Nc3ccc(Oc4cccc(F)c4)c(Cl)c3)c2c1
Standard InChI: InChI=1S/C24H21ClFN5O2/c1-31(2)13-23(32)29-16-6-8-21-19(11-16)24(28-14-27-21)30-17-7-9-22(20(25)12-17)33-18-5-3-4-15(26)10-18/h3-12,14H,13H2,1-2H3,(H,29,32)(H,27,28,30)
Standard InChI Key: YBLSPUQBCOIUTG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
10.1209 -11.1291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4169 -10.7119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1151 -11.9463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8309 -10.7251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7069 -11.1159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9988 -10.7028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6970 -11.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6512 -12.3816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3611 -11.9776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3670 -11.1604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6629 -10.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9530 -11.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2490 -10.7341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5349 -11.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5290 -11.9553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2331 -12.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9430 -11.9685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6688 -9.9302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3787 -9.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0828 -9.9392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7968 -9.5393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8027 -8.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0987 -8.3049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3846 -8.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5126 -8.3181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5185 -7.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2326 -7.0969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2384 -6.2797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5344 -5.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8203 -6.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8144 -7.0878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9483 -5.8798 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.5009 -9.9524 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
5 7 1 0
2 5 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
8 17 2 0
12 17 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
26 31 2 0
25 26 1 0
28 32 1 0
22 25 1 0
21 33 1 0
18 19 1 0
11 18 1 0
4 14 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.92Molecular Weight (Monoisotopic): 465.1368AlogP: 5.46#Rotatable Bonds: 7Polar Surface Area: 79.38Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.31CX Basic pKa: 7.14CX LogP: 4.84CX LogD: 4.64Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -1.86
References 1. Elwaie TA,Abbas SE,Aly EI,George RF,Ali H,Kraiouchkine N,Abdelwahed KS,Fandy TE,El Sayed KA,Abd Elmageed ZY,Ali HI. (2020) HER2 Kinase-Targeted Breast Cancer Therapy: Design, Synthesis, and In Vitro and In Vivo Evaluation of Novel Lapatinib Congeners as Selective and Potent HER2 Inhibitors with Favorable Metabolic Stability., 63 (24.0): [PMID:33314925 ] [10.1021/acs.jmedchem.0c01647 ]