The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
({(2R,3S,4R,5R)-5-[6-Chloro-4-(cyclopentylamino)-1H-pyrazolo-[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl}methoxy)-(phosphono)acetic Acid ID: ALA4781819
PubChem CID: 156064944
Max Phase: Preclinical
Molecular Formula: C17H23ClN5O9P
Molecular Weight: 507.82
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C(OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O
Standard InChI: InChI=1S/C17H23ClN5O9P/c18-17-21-12(20-7-3-1-2-4-7)8-5-19-23(13(8)22-17)14-11(25)10(24)9(32-14)6-31-16(15(26)27)33(28,29)30/h5,7,9-11,14,16,24-25H,1-4,6H2,(H,26,27)(H,20,21,22)(H2,28,29,30)/t9-,10-,11-,14-,16?/m1/s1
Standard InChI Key: PTRPYXPJAKIGAI-BHCDIJIXSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
5.2086 -8.4691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6308 -7.8913 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
4.4193 -8.6806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6220 -7.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0667 -6.8134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4034 -7.2935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6539 -8.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4752 -8.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7299 -7.2935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9595 -8.7381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1738 -8.7381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7618 -4.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3532 -5.5525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7618 -6.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5831 -6.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9917 -5.5525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5831 -4.8434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8378 -7.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1704 -7.5231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5071 -7.0430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8132 -5.5524 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2216 -4.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3532 -4.1302 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.0169 -7.5921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2387 -7.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8554 -7.6422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0340 -4.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2033 -3.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4943 -3.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8869 -4.0940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0668 -6.5437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6727 -5.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2890 -6.2931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
5 9 1 0
8 10 1 6
7 11 1 6
6 4 1 1
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 2 0
18 19 2 0
19 20 1 0
14 20 1 0
15 18 1 0
21 22 1 0
16 21 1 0
12 23 1 0
9 20 1 1
4 24 1 0
24 25 1 0
25 2 1 0
2 26 2 0
22 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 22 1 0
25 31 1 0
31 32 2 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.82Molecular Weight (Monoisotopic): 507.0922AlogP: 0.06#Rotatable Bonds: 8Polar Surface Area: 209.38Molecular Species: ACIDHBA: 11HBD: 6#RO5 Violations: 3HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.11CX Basic pKa: 0.76CX LogP: -1.33CX LogD: -6.50Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.21Np Likeness Score: -0.20
References 1. Du X,Moore J,Blank BR,Eksterowicz J,Sutimantanapi D,Yuen N,Metzger T,Chan B,Huang T,Chen X,Chen Y,Duong F,Kong W,Chang JH,Sun J,Zavorotinskaya T,Ye Q,Junttila MR,Ndubaku C,Friedman LS,Fantin VR,Sun D. (2020) Orally Bioavailable Small-Molecule CD73 Inhibitor (OP-5244) Reverses Immunosuppression through Blockade of Adenosine Production., 63 (18): [PMID:32865411 ] [10.1021/acs.jmedchem.0c01086 ]