3-((5,7-di-tert-butylbenzofuran-2-yl)(phenyl)methyl)-5-nitro-1H-indole

ID: ALA4781840

PubChem CID: 162664325

Max Phase: Preclinical

Molecular Formula: C31H32N2O3

Molecular Weight: 480.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1cc(C(C)(C)C)c2oc(C(c3ccccc3)c3c[nH]c4ccc([N+](=O)[O-])cc34)cc2c1

Standard InChI:  InChI=1S/C31H32N2O3/c1-30(2,3)21-14-20-15-27(36-29(20)25(16-21)31(4,5)6)28(19-10-8-7-9-11-19)24-18-32-26-13-12-22(33(34)35)17-23(24)26/h7-18,28,32H,1-6H3

Standard InChI Key:  PWFZMPNCKFLGGB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   36.9249  -17.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9238  -18.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6318  -18.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6300  -17.3382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3386  -17.7434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3434  -18.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1235  -18.8105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.6008  -18.1454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1157  -17.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4180  -18.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8307  -18.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8224  -17.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0900  -16.1387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4860  -16.6892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4238  -19.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8359  -20.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6539  -20.2551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0582  -19.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6437  -18.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8001  -16.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6335  -17.3405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2400  -17.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0133  -17.6263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1766  -16.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5689  -16.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2171  -17.3386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2169  -16.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5095  -17.7474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5065  -16.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6329  -19.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9257  -20.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3411  -20.2004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6279  -20.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6279  -18.1692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.4035  -17.9117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.4632  -18.9696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 21  1  0
 20 13  1  0
 13 14  1  0
 14 12  2  0
 11 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 11  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  1 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
  3 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
 34 35  2  0
 34 36  1  0
 23 34  1  0
M  CHG  2  34   1  36  -1
M  END

Alternative Forms

  1. Parent:

    ALA4781840

    ---

Associated Targets(Human)

SiHa (2051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 480.61Molecular Weight (Monoisotopic): 480.2413AlogP: 8.60#Rotatable Bonds: 4
Polar Surface Area: 72.07Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 8.62CX LogD: 8.62
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.21Np Likeness Score: -0.54

References

1. Siddiqui SK,SahayaSheela VJ,Kolluru S,Pandian GN,Santhoshkumar TR,Dan VM,Ramana CV.  (2020)  Discovery of 3-(benzofuran-2-ylmethyl)-1H-indole derivatives as potential autophagy inducers in cervical cancer cells.,  30  (19): [PMID:32769048] [10.1016/j.bmcl.2020.127431]

Source