The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine ID: ALA4781903
PubChem CID: 53345248
Max Phase: Preclinical
Molecular Formula: C22H24N4O
Molecular Weight: 360.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc2cc(-c3nc(C(C)(C)C)n4ccnc(N)c34)ccc2c1
Standard InChI: InChI=1S/C22H24N4O/c1-5-27-17-9-8-14-12-16(7-6-15(14)13-17)18-19-20(23)24-10-11-26(19)21(25-18)22(2,3)4/h6-13H,5H2,1-4H3,(H2,23,24)
Standard InChI Key: SORJWXKYZACWJA-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
7.2567 -9.5746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2555 -10.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9703 -10.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9685 -9.1619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6838 -9.5710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6846 -10.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3999 -10.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1149 -10.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1102 -9.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3943 -9.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8351 -10.8009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1419 -11.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5875 -10.4625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7322 -11.7894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9261 -11.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3766 -12.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6278 -13.0096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4339 -13.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9888 -12.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5701 -12.0512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9621 -10.9838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4496 -11.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2946 -10.2288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7829 -10.9830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5421 -9.1623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8278 -9.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1132 -9.1626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
11 15 2 0
14 12 1 0
12 13 2 0
13 11 1 0
8 11 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
16 20 1 0
12 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
1 25 1 0
25 26 1 0
26 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 360.46Molecular Weight (Monoisotopic): 360.1950AlogP: 4.83#Rotatable Bonds: 3Polar Surface Area: 65.44Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.63CX LogP: 4.10CX LogD: 4.10Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.57Np Likeness Score: -0.84