(R)-3-((3,5-dimethyl-4-(prop-2-ynylcarbamoyl)-1H-pyrrol-2-yl)methylene)-2-oxo-N-(1-phenylethyl)indoline-5-carboxamide

ID: ALA4782014

PubChem CID: 162664144

Max Phase: Preclinical

Molecular Formula: C28H26N4O3

Molecular Weight: 466.54

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  C#CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(C(=O)N[C@H](C)c4ccccc4)cc32)c1C

Standard InChI:  InChI=1S/C28H26N4O3/c1-5-13-29-28(35)25-16(2)24(30-18(25)4)15-22-21-14-20(11-12-23(21)32-27(22)34)26(33)31-17(3)19-9-7-6-8-10-19/h1,6-12,14-15,17,30H,13H2,2-4H3,(H,29,35)(H,31,33)(H,32,34)/b22-15-/t17-/m1/s1

Standard InChI Key:  KIHFNNZABDKAOK-JVDNRXPZSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   21.2167   -4.5440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2155   -5.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9236   -5.7725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9218   -4.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6304   -4.5404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6352   -5.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4196   -5.6134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8996   -4.9446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4118   -4.2815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7168   -4.9398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6597   -3.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4581   -3.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0697   -3.8700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7750   -3.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6004   -2.6588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7872   -2.5783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3746   -1.8730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5235   -3.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5089   -4.1356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5087   -3.3184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8012   -4.5444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0934   -4.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3858   -4.5447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0932   -3.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6765   -4.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9694   -4.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9691   -5.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6819   -5.7725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3861   -5.3621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1436   -2.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9439   -2.2134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4871   -1.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2874   -1.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8864   -1.2726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0828   -1.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  8 10  2  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  2  0
 16 17  1  0
 14 18  1  0
  1 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  1
 23 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 23  1  0
 15 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 30 34  2  0
 33 35  3  0
M  END

Alternative Forms

1. Parent:

   

   ALA4782014

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 466.54

Molecular Weight (Monoisotopic): 466.2005

AlogP: 3.98

#Rotatable Bonds: 6

Polar Surface Area: 103.09

Molecular Species: NEUTRAL

HBA: 3

HBD: 4

#RO5 Violations: ┄

HBA (Lipinski): 7

HBD (Lipinski): 4

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 10.92

CX Basic pKa: ┄

CX LogP: 3.50

CX LogD: 3.50

Aromatic Rings: 3

Heavy Atoms: 35

QED Weighted: 0.33

Np Likeness Score: -1.00

References

1. Rowlands RA,Chen Q,Bouley RA,Avramova LV,Tesmer JJG,White AD.  (2021)  Generation of Highly Selective, Potent, and Covalent G Protein-Coupled Receptor Kinase 5 Inhibitors.,  64  (1.0): [PMID:33393767] [10.1021/acs.jmedchem.0c01522]

2. Cho, Sung Yun SY and 9 more authors.  2013-12-15  Design and synthesis of novel 3-(benzo[d]oxazol-2-yl)-5-(1-(piperidin-4-yl)-1H-pyrazol-4-yl)pyridin-2-amine derivatives as selective G-protein-coupled receptor kinase-2 and -5 inhibitors.  [PMID:24210504]

Source

Source(1):

• Scientific Literature