(S)-Amino(2-(3-(1-decyl-1H-indol-5-yl)-1,2,4-oxadiazol-5-yl)pyrrolidin-l-yl)methaniminium chloride

ID: ALA4782021

PubChem CID: 162664253

Max Phase: Preclinical

Molecular Formula: C25H37ClN6O

Molecular Weight: 436.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCn1ccc2cc(-c3noc([C@@H]4CCCN4C(=N)N)n3)ccc21.Cl

Standard InChI:  InChI=1S/C25H36N6O.ClH/c1-2-3-4-5-6-7-8-9-15-30-17-14-19-18-20(12-13-21(19)30)23-28-24(32-29-23)22-11-10-16-31(22)25(26)27;/h12-14,17-18,22H,2-11,15-16H2,1H3,(H3,26,27);1H/t22-;/m0./s1

Standard InChI Key:  BKOYVXHTMTUCQE-FTBISJDPSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   10.9607  -16.0580    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.9210  -18.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5874  -18.9110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2556  -18.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0017  -17.6420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1767  -17.6410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0385  -18.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2923  -19.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1173  -19.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3735  -18.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7065  -18.1971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7076  -17.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4227  -16.9604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9938  -16.9585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1411  -18.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5290  -18.1232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1884  -19.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9704  -19.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5711  -19.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7430  -18.3791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0307  -17.9671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4187  -18.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7529  -19.2690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3398  -19.9832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7517  -20.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3385  -21.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7504  -22.1269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3374  -22.8411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7493  -23.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3362  -24.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7481  -24.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3350  -25.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7469  -26.4139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  2  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
  7  4  1  1
 11 12  1  0
 12 13  2  0
 12 14  1  0
 15 16  2  0
 16 20  1  0
 19 17  1  0
 17 18  2  0
 18 15  1  0
  2 15  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
M  END

Associated Targets(Human)

SPHK1 Tchem Sphingosine kinase 1 (1990 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SPHK2 Tchem Sphingosine kinase 2 (1579 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.60Molecular Weight (Monoisotopic): 436.2951AlogP: 5.86#Rotatable Bonds: 11
Polar Surface Area: 96.96Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 11.23CX LogP: 6.51CX LogD: 4.04
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.22Np Likeness Score: -1.19

References

1. Congdon M,Fritzemeier RG,Kharel Y,Brown AM,Serbulea V,Bevan DR,Lynch KR,Santos WL.  (2021)  Probing the substitution pattern of indole-based scaffold reveals potent and selective sphingosine kinase 2 inhibitors.,  212  [PMID:33445156] [10.1016/j.ejmech.2020.113121]

Source