The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-Amino(2-(3-(1-decyl-1H-indol-5-yl)-1,2,4-oxadiazol-5-yl)pyrrolidin-l-yl)methaniminium chloride ID: ALA4782021
PubChem CID: 162664253
Max Phase: Preclinical
Molecular Formula: C25H37ClN6O
Molecular Weight: 436.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCn1ccc2cc(-c3noc([C@@H]4CCCN4C(=N)N)n3)ccc21.Cl
Standard InChI: InChI=1S/C25H36N6O.ClH/c1-2-3-4-5-6-7-8-9-15-30-17-14-19-18-20(12-13-21(19)30)23-28-24(32-29-23)22-11-10-16-31(22)25(26)27;/h12-14,17-18,22H,2-11,15-16H2,1H3,(H3,26,27);1H/t22-;/m0./s1
Standard InChI Key: BKOYVXHTMTUCQE-FTBISJDPSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
10.9607 -16.0580 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.9210 -18.4249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5874 -18.9110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2556 -18.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0017 -17.6420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1767 -17.6410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0385 -18.6810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2923 -19.4660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1173 -19.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3735 -18.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7065 -18.1971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7076 -17.3720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4227 -16.9604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9938 -16.9585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1411 -18.6779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5290 -18.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1884 -19.7377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9704 -19.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5711 -19.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7430 -18.3791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0307 -17.9671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4187 -18.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7529 -19.2690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3398 -19.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7517 -20.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3385 -21.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7504 -22.1269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3374 -22.8411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7493 -23.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3362 -24.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7481 -24.9849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3350 -25.6991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7469 -26.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
7 4 1 1
11 12 1 0
12 13 2 0
12 14 1 0
15 16 2 0
16 20 1 0
19 17 1 0
17 18 2 0
18 15 1 0
2 15 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.60Molecular Weight (Monoisotopic): 436.2951AlogP: 5.86#Rotatable Bonds: 11Polar Surface Area: 96.96Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 11.23CX LogP: 6.51CX LogD: 4.04Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.22Np Likeness Score: -1.19
References 1. Congdon M,Fritzemeier RG,Kharel Y,Brown AM,Serbulea V,Bevan DR,Lynch KR,Santos WL. (2021) Probing the substitution pattern of indole-based scaffold reveals potent and selective sphingosine kinase 2 inhibitors., 212 [PMID:33445156 ] [10.1016/j.ejmech.2020.113121 ]