N-(3-methoxyphenyl)-7-(2-methylpyridin-4-yl)-2,3-dihydrobenzo[f][1,4]oxazepine-4(5H)-carboxamide

ID: ALA4782047

PubChem CID: 162664539

Max Phase: Preclinical

Molecular Formula: C23H23N3O3

Molecular Weight: 389.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(NC(=O)N2CCOc3ccc(-c4ccnc(C)c4)cc3C2)c1

Standard InChI:  InChI=1S/C23H23N3O3/c1-16-12-18(8-9-24-16)17-6-7-22-19(13-17)15-26(10-11-29-22)23(27)25-20-4-3-5-21(14-20)28-2/h3-9,12-14H,10-11,15H2,1-2H3,(H,25,27)

Standard InChI Key:  HPGNBQKHRDGHKC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   17.5187  -24.6024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5175  -25.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2256  -25.8309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2238  -24.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8114  -25.8302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1037  -25.4194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3962  -25.8267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3951  -26.6448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1074  -27.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8121  -26.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9372  -25.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9324  -24.5988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5734  -24.0778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5872  -25.9287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3778  -24.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3902  -25.7374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7392  -24.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9065  -26.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6161  -27.1347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7132  -26.2404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2296  -26.8738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9364  -27.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4520  -28.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2597  -28.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5491  -27.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0317  -26.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3553  -27.2371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8739  -27.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6890  -25.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3 11  2  0
 12  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  2  5  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 13 15  1  0
 14 16  1  0
 15 17  1  0
 16 17  1  0
 16 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 25 27  1  0
 27 28  1  0
  7 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4782047

    ---

Associated Targets(Human)

GPR142 Tchem Probable G-protein coupled receptor 142 (378 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.45Molecular Weight (Monoisotopic): 389.1739AlogP: 4.49#Rotatable Bonds: 3
Polar Surface Area: 63.69Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.96CX Basic pKa: 5.87CX LogP: 3.12CX LogD: 3.11
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.72Np Likeness Score: -1.54

References

1. Wilson JE,Kurukulasuriya R,Sinz C,Lombardo M,Bender K,Parker D,Sherer EC,Costa M,Dingley K,Li X,Mitelman S,Tong S,Bugianesi R,Ehrhardt A,Priest B,Ratliff K,Ujjainwalla F,Nargund R,Hagmann WK,Edmondson S.  (2016)  Discovery and development of benzo-[1,2,4]-triazolo-[1,4]-oxazepine GPR142 agonists for the treatment of diabetes.,  26  (12.0): [PMID:27240550] [10.1016/j.bmcl.2016.04.018]

Source