(3S,4S)-1-Cyclopropylmethyl-4-([5-(2,4-difluoro-phenyl)isoxazole-3-carbonyl]-amino)-piperidine-3-carboxylic acid (1-Pyrimidin-2-yl-cyclopropyl)-amide

ID: ALA4782111

PubChem CID: 139360137

Max Phase: Preclinical

Molecular Formula: C27H28F2N6O3

Molecular Weight: 522.56

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  O=C(N[C@H]1CCN(CC2CC2)C[C@@H]1C(=O)NC1(c2ncccn2)CC1)c1cc(-c2ccc(F)cc2F)on1

Standard InChI:  InChI=1S/C27H28F2N6O3/c28-17-4-5-18(20(29)12-17)23-13-22(34-38-23)25(37)32-21-6-11-35(14-16-2-3-16)15-19(21)24(36)33-27(7-8-27)26-30-9-1-10-31-26/h1,4-5,9-10,12-13,16,19,21H,2-3,6-8,11,14-15H2,(H,32,37)(H,33,36)/t19-,21-/m0/s1

Standard InChI Key:  IIDSHAJKXPUYSL-FPOVZHCZSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
    4.9733  -19.4681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5688  -20.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3859  -20.1734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8866  -16.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5970  -16.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3387  -16.4279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8896  -15.8243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4857  -15.1138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6853  -15.2784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8206  -14.3707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6351  -14.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9724  -13.5484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4963  -12.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6791  -12.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3455  -13.7099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8326  -12.1384    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.5325  -13.7921    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1816  -16.0845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8811  -17.3150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1707  -17.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4671  -17.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7588  -17.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7491  -18.5207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4538  -18.9362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1683  -18.5342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8731  -18.9478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5837  -18.5442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8674  -19.7650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5665  -20.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8532  -21.3956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8471  -22.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5525  -22.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2654  -22.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2680  -21.4033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0371  -18.9218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0285  -19.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6131  -20.4469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4303  -20.4555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
 13 16  1  0
 15 17  1  0
  4 18  2  0
  4 19  1  0
 20 19  1  6
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  1
 26 27  2  0
 26 28  1  0
 28  2  1  0
  2 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 23 35  1  0
 35 36  1  0
 37 36  1  0
 38 37  1  0
 36 38  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4782111

   ---

2. Alternative Forms:

   

   ALA4782111

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 522.56

Molecular Weight (Monoisotopic): 522.2191

AlogP: 3.05

#Rotatable Bonds: 8

Polar Surface Area: 113.25

Molecular Species: BASE

HBA: 7

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 11.92

CX Basic pKa: 8.87

CX LogP: 2.24

CX LogD: 0.76

Aromatic Rings: 3

Heavy Atoms: 38

QED Weighted: 0.47

Np Likeness Score: -1.64

References

1. Richard-Bildstein S,Aissaoui H,Pothier J,Schäfer G,Gnerre C,Lindenberg E,Lehembre F,Pouzol L,Guerry P.  (2020)  Discovery of the Potent, Selective, Orally Available CXCR7 Antagonist ACT-1004-1239.,  63  (24): [PMID:33314938] [10.1021/acs.jmedchem.0c01588]

2.  (2021)  Crystalline forms of the cxcr7 receptor antagonist (3s,4s)-1-cyclopropylmethyl-4-{[5-(2,4-difluoro-phenyl)-isoxazole-3-carbonyl]-amino}-piperidine-3-carboxylic acid (1-pyrimidin-2-yl-cyclopropyl)-amide, 

Source

Source(2):

• Scientific Literature
• Patent Bioactivity Data