N-(3-(4-Fluorobenzamido)benzyl)-3-benzyloxybenzothiophene-2-carboxamide

ID: ALA4782207

PubChem CID: 162664852

Max Phase: Preclinical

Molecular Formula: C30H23FN2O3S

Molecular Weight: 510.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1cccc(CNC(=O)c2sc3ccccc3c2OCc2ccccc2)c1)c1ccc(F)cc1

Standard InChI:  InChI=1S/C30H23FN2O3S/c31-23-15-13-22(14-16-23)29(34)33-24-10-6-9-21(17-24)18-32-30(35)28-27(25-11-4-5-12-26(25)37-28)36-19-20-7-2-1-3-8-20/h1-17H,18-19H2,(H,32,35)(H,33,34)

Standard InChI Key:  BTFLQIBOLMOCRG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   29.6976  -17.8328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1848  -18.4721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4824  -19.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2924  -19.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5036  -17.9538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8057  -18.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6241  -18.6643    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.8278  -17.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1352  -17.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5874  -17.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2281  -18.0762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7065  -16.7604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9877  -17.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6284  -18.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5081  -19.0879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1479  -19.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9085  -19.2940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0256  -18.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3847  -17.9774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7842  -18.1771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4266  -18.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1853  -18.3783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8265  -18.8877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5845  -18.5845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7013  -17.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0539  -17.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2984  -17.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3105  -19.4910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.0836  -16.6154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3515  -16.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2999  -15.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9830  -14.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9318  -14.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1991  -13.8094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5165  -14.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5712  -15.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4595  -17.4699    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 21 28  2  0
  9 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 25 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4782207

    ---

Associated Targets(Human)

SENP1 Tchem Sentrin-specific protease 1 (681 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SENP2 Tchem Sentrin-specific protease 2 (79 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SENP5 Tbio Sentrin-specific protease 5 (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 510.59Molecular Weight (Monoisotopic): 510.1413AlogP: 6.80#Rotatable Bonds: 8
Polar Surface Area: 67.43Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.58CX LogD: 6.58
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -1.55

References

1. Wang Z,Liu Y,Zhang J,Ullah S,Kang N,Zhao Y,Zhou H.  (2020)  Benzothiophene-2-carboxamide derivatives as SENPs inhibitors with selectivity within SENPs family.,  204  [PMID:32717481] [10.1016/j.ejmech.2020.112553]

Source