4-(((2'S,3'S,4'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-5'-methyl-2-oxospiro[indoline-3,2'-pyrrolidine]-4'-ylamino)methyl)benzoic acid

ID: ALA4782226

PubChem CID: 162665106

Max Phase: Preclinical

Molecular Formula: C30H28Cl2FN3O3

Molecular Weight: 568.48

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  C[C@H]1[C@@H](NCc2ccc(C(=O)O)cc2)[C@H](c2cccc(Cl)c2F)[C@]2(C(=O)Nc3cc(Cl)ccc32)N1CC1CC1

Standard InChI:  InChI=1S/C30H28Cl2FN3O3/c1-16-27(34-14-17-7-9-19(10-8-17)28(37)38)25(21-3-2-4-23(32)26(21)33)30(36(16)15-18-5-6-18)22-12-11-20(31)13-24(22)35-29(30)39/h2-4,7-13,16,18,25,27,34H,5-6,14-15H2,1H3,(H,35,39)(H,37,38)/t16-,25-,27+,30+/m0/s1

Standard InChI Key:  LOSZKERARNYENB-VBIQYGPKSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
    5.7579  -21.9763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5283  -21.7042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5076  -20.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7244  -20.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2612  -21.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5645  -22.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5634  -23.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2714  -23.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2696  -21.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9782  -22.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9830  -23.0525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7631  -23.3009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2404  -22.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0576  -22.6321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8553  -23.4650    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.5482  -20.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5504  -20.0928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8383  -19.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1249  -20.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1282  -20.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8409  -21.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8381  -18.8648    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.4527  -19.8806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2014  -22.1676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9392  -21.8164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1563  -20.3905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7587  -19.2989    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.7514  -21.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4002  -21.1387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9852  -19.2607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7147  -18.4896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2495  -17.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9795  -17.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1757  -16.9529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6424  -17.5777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9152  -18.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9046  -16.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4362  -15.5589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1013  -16.0293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8 11  2  0
 10  9  2  0
  9  6  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  1  1  0
  1 10  1  6
 13 14  2  0
  7 15  1  0
  5 16  1  1
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 18 22  1  0
  4 23  1  6
  2 24  1  0
 24 25  1  0
  3 26  1  6
 17 27  1  0
 28 25  1  0
 29 28  1  0
 25 29  1  0
 23 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 37 38  1  0
 37 39  2  0
 34 37  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4782226

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 568.48

Molecular Weight (Monoisotopic): 567.1492

AlogP: 6.03

#Rotatable Bonds: 7

Polar Surface Area: 81.67

Molecular Species: ZWITTERION

HBA: 4

HBD: 3

#RO5 Violations: 2

HBA (Lipinski): 6

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 3.91

CX Basic pKa: 8.99

CX LogP: 3.80

CX LogD: 3.79

Aromatic Rings: 3

Heavy Atoms: 39

QED Weighted: 0.32

Np Likeness Score: -0.45

References

1. Gollner A,Rudolph D,Arnhof H,Bauer M,Blake SM,Boehmelt G,Cockroft XL,Dahmann G,Ettmayer P,Gerstberger T,Karolyi-Oezguer J,Kessler D,Kofink C,Ramharter J,Rinnenthal J,Savchenko A,Schnitzer R,Weinstabl H,Weyer-Czernilofsky U,Wunberg T,McConnell DB.  (2016)  Discovery of Novel Spiro[3H-indole-3,2'-pyrrolidin]-2(1H)-one Compounds as Chemically Stable and Orally Active Inhibitors of the MDM2-p53 Interaction.,  59  (22): [PMID:27775892] [10.1021/acs.jmedchem.6b00900]

Source

Source(1):

• Scientific Literature